EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77520 - 3-methyl-2-pentanol
| Formula | C6H14O |
| Net Charge | 0 |
| Average Mass | 102.177 |
| Monoisotopic Mass | 102.10447 |
| SMILES | CCC(C)C(C)O |
| InChI | InChI=1S/C6H14O/c1-4-5(2)6(3)7/h5-7H,4H2,1-3H3 |
| InChIKey | ZXNBBWHRUSXUFZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methyl-2-pentanol (CHEBI:77520) has role biomarker (CHEBI:59163) |
| 3-methyl-2-pentanol (CHEBI:77520) has role human xenobiotic metabolite (CHEBI:76967) |
| 3-methyl-2-pentanol (CHEBI:77520) has role plant metabolite (CHEBI:76924) |
| 3-methyl-2-pentanol (CHEBI:77520) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| 3-methylpentan-2-ol |
| Synonyms | Source |
|---|---|
| 2-hydroxy-3-methylpentane | ChEBI |
| 3-Methyl-4-pentanol | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 3-Methyl-2-pentanol | Wikipedia |
| WO2004006875 | Patent |
| EP1531781 | Patent |
| US2007128139 | Patent |
| Citations |
|---|