EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C45H74O10 |
| Net Charge | 0 |
| Average Mass | 775.077 |
| Monoisotopic Mass | 774.52820 |
| SMILES | CC[C@H]1/C=C/C=C/C[C@@H](C)[C@H](O)[C@H](C)C(=O)[C@@H](C)[C@H](O)[C@@H](C)C(=O)[C@@H](C)[C@H](O)[C@@H](C)/C=C/C(=O)O[C@@H]2[C@H](C)[C@H](CC1)O[C@]1(CC[C@H](C)[C@H](C[C@@H](C)O)O1)[C@H]2C |
| InChI | InChI=1S/C45H74O10/c1-12-35-17-15-13-14-16-26(3)39(48)30(7)41(50)32(9)43(52)33(10)42(51)31(8)40(49)27(4)18-21-38(47)53-44-29(6)36(20-19-35)54-45(34(44)11)23-22-25(2)37(55-45)24-28(5)46/h13-15,17-18,21,25-37,39-40,43-44,46,48-49,52H,12,16,19-20,22-24H2,1-11H3/b14-13+,17-15+,21-18+/t25-,26+,27-,28+,29+,30-,31-,32+,33-,34-,35-,36-,37-,39-,40+,43-,44+,45-/m0/s1 |
| InChIKey | CMMLZMMKTYEOKV-RDKHTNMBSA-N |
| Roles Classification |
|---|
| Biological Roles: | EC 3.6.3.14 (H(+)-transporting two-sector ATPase) inhibitor An EC 3.6.3.* (acid anhydride hydrolase catalysing transmembrane movement of substances) inhibitor that interferes with the action of H+-transporting two-sector ATPase inhibitor (EC 3.6.3.14). ATP synthase inhibitor A mitochondrial respiratory-chain inhibitor that interferes with the action of ATP synthase. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oligomycin C (CHEBI:7752) has role EC 3.6.3.14 (H+-transporting two-sector ATPase) inhibitor (CHEBI:73214) |
| oligomycin C (CHEBI:7752) is a diketone (CHEBI:46640) |
| oligomycin C (CHEBI:7752) is a oligomycin (CHEBI:25675) |
| oligomycin C (CHEBI:7752) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (1R,4E,5'S,6S,6'S,7R,8S,10R,11S,12S,14S,15S,16R,18E,20E,22R,25S,27R,28S,29R)-22-ethyl-7,11,15-trihydroxy-6'-[(2R)-2-hydroxypropyl]-5',6,8,10,12,14,16,28,29-nonamethyl-3',4',5',6'-tetrahydro-3H,9H,13H-spiro[2,26-dioxabicyclo[23.3.1]nonacosa-4,18,20-triene-27,2'-pyran]-3,9,13-trione |
| Synonyms | Source |
|---|---|
| 12-deoxy-oligomycin A | ChemIDplus |
| 12-deoxyoligomycin A | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:11052-72-5 | KEGG COMPOUND |
| CAS:11052-72-5 | ChemIDplus |
| Citations |
|---|