EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77519 - pentan-3-ol
| Formula | C5H12O |
| Net Charge | 0 |
| Average Mass | 88.150 |
| Monoisotopic Mass | 88.08882 |
| SMILES | CCC(O)CC |
| InChI | InChI=1S/C5H12O/c1-3-5(6)4-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | AQIXEPGDORPWBJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | fuel additive Any additive that enhances the efficiency of fuel. |
| Biological Roles: | pheromone A semiochemical used in olfactory communication between organisms of the same species eliciting a change in sexual or social behaviour. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | biomarker A substance used as an indicator of a biological state. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentan-3-ol (CHEBI:77519) has role biomarker (CHEBI:59163) |
| pentan-3-ol (CHEBI:77519) has role fuel additive (CHEBI:62803) |
| pentan-3-ol (CHEBI:77519) has role pheromone (CHEBI:26013) |
| pentan-3-ol (CHEBI:77519) has role plant metabolite (CHEBI:76924) |
| pentan-3-ol (CHEBI:77519) is a pentanol (CHEBI:143597) |
| pentan-3-ol (CHEBI:77519) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| pentan-3-ol |
| Synonyms | Source |
|---|---|
| sec-pentyl alcohol | ChemIDplus |
| 3-Pentyl alcohol | ChemIDplus |
| sec-amyl alcohol | ChemIDplus |
| sec-pentanol | ChemIDplus |
| diethyl carbinol | ChemIDplus |
| (C2H5)2CHOH | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 3-Pentanol | Wikipedia |
| FDB029632 | FooDB |
| C00053663 | KNApSAcK |
| HMDB0303831 | HMDB |
| Citations |
|---|