EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H70O12 |
| Net Charge | 0 |
| Average Mass | 754.999 |
| Monoisotopic Mass | 754.48673 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@](C)(CCC=C(C)C)O[C@@H]4O[C@H](CO[C@@H]5OC[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C41H70O12/c1-21(2)10-9-14-41(8,53-36-34(49)32(47)31(46)25(52-36)20-51-35-33(48)30(45)24(43)19-50-35)22-11-16-40(7)29(22)23(42)18-27-38(5)15-13-28(44)37(3,4)26(38)12-17-39(27,40)6/h10,22-36,42-49H,9,11-20H2,1-8H3/t22-,23+,24+,25+,26-,27+,28-,29-,30-,31+,32-,33+,34+,35-,36-,38-,39+,40+,41-/m0/s1 |
| InChIKey | YNBYFOIDLBTOMW-IPTBNLQOSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ginsenoside Mx (CHEBI:77490) has functional parent (20S)-protopanaxadiol (CHEBI:75950) |
| ginsenoside Mx (CHEBI:77490) has parent hydride dammarane (CHEBI:36488) |
| ginsenoside Mx (CHEBI:77490) has role antineoplastic agent (CHEBI:35610) |
| ginsenoside Mx (CHEBI:77490) has role plant metabolite (CHEBI:76924) |
| ginsenoside Mx (CHEBI:77490) is a 3β-hydroxy-4,4-dimethylsteroid (CHEBI:143563) |
| ginsenoside Mx (CHEBI:77490) is a disaccharide derivative (CHEBI:63353) |
| ginsenoside Mx (CHEBI:77490) is a ginsenoside (CHEBI:74978) |
| ginsenoside Mx (CHEBI:77490) is a tetracyclic triterpenoid (CHEBI:26893) |
| ginsenoside Mx (CHEBI:77490) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β,12β)-3,12-dihydroxydammar-24-en-20-yl 6-O-β-D-xylopyranosyl-β-D-glucopyranoside |
| UniProt Name | Source |
|---|---|
| ginsenoside Mx | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15456 | MetaCyc |
| WO2004054590 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10143427 | Reaxys |