EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O3 |
| Net Charge | 0 |
| Average Mass | 162.189 |
| Monoisotopic Mass | 162.10044 |
| SMILES | NCCC[C@H](O)[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O3/c7-3-1-2-4(9)5(8)6(10)11/h4-5,9H,1-3,7-8H2,(H,10,11)/t4-,5-/m0/s1 |
| InChIKey | YSVMULOOWPBERR-WHFBIAKZSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3S)-3-hydroxy-L-lysine (CHEBI:77482) is a L-lysine derivative (CHEBI:25095) |
| (3S)-3-hydroxy-L-lysine (CHEBI:77482) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| (3S)-3-hydroxy-L-lysine (CHEBI:77482) is conjugate base of (3S)-3-hydroxy-L-lysine(1+) (CHEBI:77409) |
| Incoming Relation(s) |
| (3S)-3-hydroxy-L-lysine(1+) (CHEBI:77409) is conjugate acid of (3S)-3-hydroxy-L-lysine (CHEBI:77482) |
| IUPAC Name |
|---|
| (3S)-3-hydroxy-L-lysine |
| Synonym | Source |
|---|---|
| (3S)-3-hydroxylysine | ChEBI |