EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32O13 |
| Net Charge | 0 |
| Average Mass | 540.518 |
| Monoisotopic Mass | 540.18429 |
| SMILES | [H][C@@]1(CC(=O)OCCc2ccc(O)c(O)c2)C(C(=O)OC)=CO[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)/C1=C/C |
| InChI | InChI=1S/C25H32O13/c1-3-13-14(9-19(29)35-7-6-12-4-5-16(27)17(28)8-12)15(23(33)34-2)11-36-24(13)38-25-22(32)21(31)20(30)18(10-26)37-25/h3-5,8,11,14,18,20-22,24-28,30-32H,6-7,9-10H2,1-2H3/b13-3+/t14-,18+,20+,21-,22+,24-,25-/m0/s1 |
| InChIKey | RFWGABANNQMHMZ-ZCHJGGQASA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Olea europaea (ncbitaxon:4146) | |||
| leaf (BTO:0000713) | PubMed (28576392) | Found particularly in leaves, bark and branches | |
| leaf (BTO:0000713) | PubMed (22014168) | Methanolic and aqueous extract of dried olive leaves |
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Roles: | NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. nutraceutical A product in capsule, tablet or liquid form that provide essential nutrients, such as a vitamin, an essential mineral, a protein, an herb, or similar nutritional substance. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oleuropein (CHEBI:7747) has role anti-inflammatory agent (CHEBI:67079) |
| oleuropein (CHEBI:7747) has role antihypertensive agent (CHEBI:35674) |
| oleuropein (CHEBI:7747) has role antineoplastic agent (CHEBI:35610) |
| oleuropein (CHEBI:7747) has role antioxidant (CHEBI:22586) |
| oleuropein (CHEBI:7747) has role apoptosis inducer (CHEBI:68495) |
| oleuropein (CHEBI:7747) has role NF-κB inhibitor (CHEBI:73240) |
| oleuropein (CHEBI:7747) has role nutraceutical (CHEBI:50733) |
| oleuropein (CHEBI:7747) has role plant metabolite (CHEBI:76924) |
| oleuropein (CHEBI:7747) has role radical scavenger (CHEBI:48578) |
| oleuropein (CHEBI:7747) is a catechols (CHEBI:33566) |
| oleuropein (CHEBI:7747) is a diester (CHEBI:51307) |
| oleuropein (CHEBI:7747) is a methyl ester (CHEBI:25248) |
| oleuropein (CHEBI:7747) is a pyrans (CHEBI:26407) |
| oleuropein (CHEBI:7747) is a secoiridoid glycoside (CHEBI:50274) |
| oleuropein (CHEBI:7747) is a β-D-glucoside (CHEBI:22798) |
| Incoming Relation(s) |
| oleuropein aglycone (CHEBI:139162) has functional parent oleuropein (CHEBI:7747) |
| IUPAC Name |
|---|
| methyl (2S,3E,4S)-4-{2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl}-3-ethylidene-2-(β-D-glucopyranosyloxy)-3,4-dihydro-2H-pyran-5-carboxylate |
| Synonyms | Source |
|---|---|
| 2-(3,4-dihydroxyphenyl)ethyl (2S-(2α,3E,4β))-3-ethylidene-2-(β-D-glucopyranosyloxy)-3,4-dihydro-5-(methoxycarbonyl)-2H-pyran-4-acetate | ChemIDplus |
| [2S-(2α,3E,4β)]-3-ethylidene-2-(β-D-glucopyranosyloxy)-3,4-dihydro-5-(methoxycarbonyl)-2H-pyran-4-acetic acid 2-(3,4-dihydroxyphenyl)ethyl ester | ChEBI |
| UniProt Name | Source |
|---|---|
| oleuropein | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003093 | KNApSAcK |
| C09794 | KEGG COMPOUND |
| CPD-17784 | MetaCyc |
| FDB014653 | FooDB |
| HMDB0035872 | HMDB |
| Oleuropein | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:72250 | Reaxys |
| CAS:32619-42-4 | ChemIDplus |
| CAS:32619-42-4 | KEGG COMPOUND |
| Citations |
|---|