EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO2 |
| Net Charge | 0 |
| Average Mass | 193.246 |
| Monoisotopic Mass | 193.11028 |
| SMILES | CC(C)(C)/[N+]([O-])=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C11H15NO2/c1-11(2,3)12(14)8-9-4-6-10(13)7-5-9/h4-8,13H,1-3H3/b12-8- |
| InChIKey | PSYHRZCRICXGJJ-WQLSENKSSA-N |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-(4-hydroxyphenyl)-N-tert-butylnitrone (CHEBI:77433) has role antineoplastic agent (CHEBI:35610) |
| α-(4-hydroxyphenyl)-N-tert-butylnitrone (CHEBI:77433) has role mammalian metabolite (CHEBI:75768) |
| α-(4-hydroxyphenyl)-N-tert-butylnitrone (CHEBI:77433) has role radical scavenger (CHEBI:48578) |
| α-(4-hydroxyphenyl)-N-tert-butylnitrone (CHEBI:77433) is a nitrone (CHEBI:77477) |
| α-(4-hydroxyphenyl)-N-tert-butylnitrone (CHEBI:77433) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-{[tert-butyl(oxido)-λ5-azanylidene]methyl}phenol |
| Synonyms | Source |
|---|---|
| 4-hydroxyphenyl-N-tert-butylnitrone | ChEBI |
| 4-OH-PBN | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4246344 | Reaxys |
| Citations |
|---|