EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H38O6 |
| Net Charge | 0 |
| Average Mass | 386.529 |
| Monoisotopic Mass | 386.26684 |
| SMILES | CCCCCC(=O)OCC(COC(=O)CCCCC)OC(=O)CCCCC |
| InChI | InChI=1S/C21H38O6/c1-4-7-10-13-19(22)25-16-18(27-21(24)15-12-9-6-3)17-26-20(23)14-11-8-5-2/h18H,4-17H2,1-3H3 |
| InChIKey | MAYCICSNZYXLHB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | insect repellent An insecticide that acts as a repellent to insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricaproin (CHEBI:77386) has role insect repellent (CHEBI:71692) |
| tricaproin (CHEBI:77386) is a hexanoate ester (CHEBI:87656) |
| tricaproin (CHEBI:77386) is a triglyceride (CHEBI:17855) |
| IUPAC Name |
|---|
| propane-1,2,3-triyl trihexanoate |
| Synonyms | Source |
|---|---|
| 1,2,3-Propanetriyl hexanoate | HMDB |
| 1,2,3-Tricaproylglycerol | HMDB |
| 1,2,3-trihexanoylglycerol | SUBMITTER |
| Caproic triglyceride | ChemIDplus |
| Glycerol tricaproate | ChemIDplus |
| Glycerol tricapronate | HMDB |
| UniProt Name | Source |
|---|---|
| trihexanoylglycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0031125 | HMDB |
| KR20080063014 | Patent |
| WO2008082028 | Patent |
| Citations |
|---|