EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28N2O5 |
| Net Charge | 0 |
| Average Mass | 388.464 |
| Monoisotopic Mass | 388.19982 |
| SMILES | [H][C@@]12CCC[C@]1([H])N(C(=O)[C@H](C)N[C@@H](CCc1ccccc1)C(=O)O)[C@H](C(=O)O)C2 |
| InChI | InChI=1S/C21H28N2O5/c1-13(22-16(20(25)26)11-10-14-6-3-2-4-7-14)19(24)23-17-9-5-8-15(17)12-18(23)21(27)28/h2-4,6-7,13,15-18,22H,5,8-12H2,1H3,(H,25,26)(H,27,28)/t13-,15-,16-,17-,18-/m0/s1 |
| InChIKey | KEDYTOTWMPBSLG-HILJTLORSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | bradykinin receptor B2 agonist A bradykinin agonist that binds to and activates bradykinin B2 receptors. EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). |
| Applications: | EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor An EC 3.4.15.* (peptidyl-dipeptidase) inhibitor that interferes with the action of peptidyl-dipeptidase A (EC 3.4.15.1). cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ramiprilat (CHEBI:77363) has role bradykinin receptor B2 agonist (CHEBI:77496) |
| ramiprilat (CHEBI:77363) has role cardioprotective agent (CHEBI:77307) |
| ramiprilat (CHEBI:77363) has role drug metabolite (CHEBI:49103) |
| ramiprilat (CHEBI:77363) has role EC 3.4.15.1 (peptidyl-dipeptidase A) inhibitor (CHEBI:35457) |
| ramiprilat (CHEBI:77363) has role matrix metalloproteinase inhibitor (CHEBI:50664) |
| ramiprilat (CHEBI:77363) is a azabicycloalkane (CHEBI:38295) |
| ramiprilat (CHEBI:77363) is a cyclopentapyrrole (CHEBI:38296) |
| ramiprilat (CHEBI:77363) is a dicarboxylic acid (CHEBI:35692) |
| ramiprilat (CHEBI:77363) is a dipeptide (CHEBI:46761) |
| ramiprilat (CHEBI:77363) is conjugate acid of ramiprilat(1−) (CHEBI:231705) |
| Incoming Relation(s) |
| ramiprilat(1−) (CHEBI:231705) is conjugate base of ramiprilat (CHEBI:77363) |
| IUPAC Name |
|---|
| (2S,3aS,6aS)-1-[(2S)-2-{[(1S)-1-carboxy-3-phenylpropyl]amino}propanoyl]octahydrocyclopenta[b]pyrrole-2-carboxylic acid |
| INNs | Source |
|---|---|
| ramiprilat | ChemIDplus |
| ramiprilate | ChemIDplus |
| ramiprilatum | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| EP2277519 | Patent |
| HMDB0060579 | HMDB |
| NZ571901 | Patent |
| US2011263619 | Patent |
| X92 | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4212094 | Reaxys |
| CAS:87269-97-4 | ChemIDplus |
| Citations |
|---|