EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H26O2 |
| Net Charge | 0 |
| Average Mass | 214.349 |
| Monoisotopic Mass | 214.19328 |
| SMILES | CC(C)CCCCCCCCCC(=O)O |
| InChI | InChI=1S/C13H26O2/c1-12(2)10-8-6-4-3-5-7-9-11-13(14)15/h12H,3-11H2,1-2H3,(H,14,15) |
| InChIKey | SIOLDWZBFABPJU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| isotridecanoic acid (CHEBI:77359) is a branched-chain saturated fatty acid (CHEBI:39417) |
| isotridecanoic acid (CHEBI:77359) is a medium-chain fatty acid (CHEBI:59554) |
| isotridecanoic acid (CHEBI:77359) is a methyl-branched fatty acid (CHEBI:62499) |
| isotridecanoic acid (CHEBI:77359) is conjugate acid of isotridecanoate (CHEBI:77197) |
| Incoming Relation(s) |
| isotridecanoate (CHEBI:77197) is conjugate base of isotridecanoic acid (CHEBI:77359) |
| IUPAC Name |
|---|
| 11-methyldodecanoic acid |
| Synonyms | Source |
|---|---|
| 11-methyllauric acid | ChEBI |
| C13:0 iso | ChEBI |
| i13:0 | ChEBI |
| iso-C13:0 | ChEBI |
| 13:0 iso | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1767822 | Reaxys |
| CAS:25448-24-2 | ChemIDplus |