EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O6 |
| Net Charge | 0 |
| Average Mass | 288.255 |
| Monoisotopic Mass | 288.06339 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C15H12O6/c16-10(9-3-6-12(18)15(21)14(9)20)4-1-8-2-5-11(17)13(19)7-8/h1-7,17-21H/b4-1+ |
| InChIKey | GSBNFGRTUCCBTK-DAFODLJHSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acacia confusa (ncbitaxon:3809) | - | PubMed (20047272) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| okanin (CHEBI:7734) has functional parent trans-chalcone (CHEBI:48965) |
| okanin (CHEBI:7734) has role plant metabolite (CHEBI:76924) |
| okanin (CHEBI:7734) is a benzenetriol (CHEBI:22707) |
| okanin (CHEBI:7734) is a chalcones (CHEBI:23086) |
| IUPAC Name |
|---|
| (2E)-3-(3,4-dihydroxyphenyl)-1-(2,3,4-trihydroxyphenyl)prop-2-en-1-one |
| Synonym | Source |
|---|---|
| 3,4,2',3',4'-pentahydroxy-trans-chalcone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C08724 | KEGG COMPOUND |
| C00006969 | KNApSAcK |
| LMPK12120181 | LIPID MAPS |
| Okanin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2295748 | Reaxys |
| CAS:484-76-4 | KEGG COMPOUND |
| Citations |
|---|