EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6N12O12 |
| Net Charge | 0 |
| Average Mass | 438.186 |
| Monoisotopic Mass | 438.02281 |
| SMILES | O=[N+]([O-])N1C2C3N([N+](=O)[O-])C1C1N([N+](=O)[O-])C(C(N1[N+](=O)[O-])N3[N+](=O)[O-])N2[N+](=O)[O-] |
| InChI | InChI=1S/C6H6N12O12/c19-13(20)7-1-2-8(14(21)22)5(7)6-9(15(23)24)3(11(1)17(27)28)4(10(6)16(25)26)12(2)18(29)30/h1-6H |
| InChIKey | NDYLCHGXSQOGMS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | explosive A substance capable of undergoing rapid and highly exothermic decomposition. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CL-20 (CHEBI:77327) has role explosive (CHEBI:63490) |
| CL-20 (CHEBI:77327) is a N-nitro compound (CHEBI:38780) |
| CL-20 (CHEBI:77327) is a polycyclic cage (CHEBI:33640) |
| IUPAC Name |
|---|
| 1,3,4,7,8,10-hexanitrooctahydro-1H-5,2,6-(epiminomethanetriylimino)imidazo[4,5-b]pyrazine |
| Synonyms | Source |
|---|---|
| Octahydro-1,3,4,7,8,10-hexanitro-5,2,6-(iminomethenimino)-1H-imidazo(4,5-b)pyrazine | ChemIDplus |
| Hexanitrohexaazaisowurtzitane | ChemIDplus |
| HNIW | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Hexanitrohexaazaisowurtzitane | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4834707 | Reaxys |
| CAS:135285-90-4 | ChemIDplus |
| Citations |
|---|