EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77323 - ethoxyquin
| Formula | C14H19NO |
| Net Charge | 0 |
| Average Mass | 217.312 |
| Monoisotopic Mass | 217.14666 |
| SMILES | CCOc1ccc2c(c1)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C14H19NO/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-9,15H,5H2,1-4H3 |
| InChIKey | DECIPOUIJURFOJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. |
| Biological Roles: | UDP-glucuronosyltransferase activator Any compound that activates UDP-glucuronosyltransferase (EC 2.4.1.17). food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. herbicide A substance used to destroy plant pests. food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethoxyquin (CHEBI:77323) has role antifungal agrochemical (CHEBI:86328) |
| ethoxyquin (CHEBI:77323) has role food antioxidant (CHEBI:77962) |
| ethoxyquin (CHEBI:77323) has role genotoxin (CHEBI:50902) |
| ethoxyquin (CHEBI:77323) has role geroprotector (CHEBI:176497) |
| ethoxyquin (CHEBI:77323) has role herbicide (CHEBI:24527) |
| ethoxyquin (CHEBI:77323) has role Hsp90 inhibitor (CHEBI:63962) |
| ethoxyquin (CHEBI:77323) has role neuroprotective agent (CHEBI:63726) |
| ethoxyquin (CHEBI:77323) has role UDP-glucuronosyltransferase activator (CHEBI:77324) |
| ethoxyquin (CHEBI:77323) is a aromatic ether (CHEBI:35618) |
| ethoxyquin (CHEBI:77323) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| 6-ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline |
| Synonyms | Source |
|---|---|
| 1,2-Dihydro-2,2,4-trimethyl-6-ethoxyquinoline | NIST Chemistry WebBook |
| 1,2-dihydro-2,2,4-trimethyl-6-quinolyl ethyl ether | Alan Wood's Pesticides |
| 1,2-Dihydro-6-ethoxy-2,2,4-trimethylquinoline | HMDB |
| 2,2,4-Trimethyl-6-ethoxy-1,2-dihydroquinoline | ChemIDplus |
| 6-Ethoxy-1,2-dihydro-2,2,4-trimethylquinoline | HMDB |
| E 324 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 280 | PPDB |
| 280 | VSDB |
| ethoxyquin | Alan Wood's Pesticides |
| Ethoxyquin | Wikipedia |
| FDB019147 | FooDB |
| HMDB0039531 | HMDB |
| LSM-5670 | LINCS |
| WO2011028128 | Patent |
| Citations |
|---|