EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:77323 - ethoxyquin
| Formula | C14H19NO |
| Net Charge | 0 |
| Average Mass | 217.312 |
| Monoisotopic Mass | 217.14666 |
| SMILES | CCOc1ccc2c(c1)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C14H19NO/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-9,15H,5H2,1-4H3 |
| InChIKey | DECIPOUIJURFOJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. |
| Biological Roles: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. UDP-glucuronosyltransferase activator Any compound that activates UDP-glucuronosyltransferase (EC 2.4.1.17). antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. |
| Applications: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. herbicide A substance used to destroy plant pests. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethoxyquin (CHEBI:77323) has role antifungal agrochemical (CHEBI:86328) |
| ethoxyquin (CHEBI:77323) has role food antioxidant (CHEBI:77962) |
| ethoxyquin (CHEBI:77323) has role genotoxin (CHEBI:50902) |
| ethoxyquin (CHEBI:77323) has role geroprotector (CHEBI:176497) |
| ethoxyquin (CHEBI:77323) has role herbicide (CHEBI:24527) |
| ethoxyquin (CHEBI:77323) has role Hsp90 inhibitor (CHEBI:63962) |
| ethoxyquin (CHEBI:77323) has role neuroprotective agent (CHEBI:63726) |
| ethoxyquin (CHEBI:77323) has role UDP-glucuronosyltransferase activator (CHEBI:77324) |
| ethoxyquin (CHEBI:77323) is a aromatic ether (CHEBI:35618) |
| ethoxyquin (CHEBI:77323) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| 6-ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline |
| Synonyms | Source |
|---|---|
| 1,2-Dihydro-2,2,4-trimethyl-6-ethoxyquinoline | NIST Chemistry WebBook |
| Ethyl 2,2,4-trimethyl-1,2-dihydro-6-quinolinyl ether | HMDB |
| 6-Ethoxy-1,2-dihydro-2,2,4-trimethylquinoline | HMDB |
| 1,2-Dihydro-6-ethoxy-2,2,4-trimethylquinoline | HMDB |
| Ethoxyquine | ChemIDplus |
| 2,2,4-Trimethyl-6-ethoxy-1,2-dihydroquinoline | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0039531 | HMDB |
| Ethoxyquin | Wikipedia |
| WO2011028128 | Patent |
| LSM-5670 | LINCS |
| 280 | PPDB |
| 280 | VSDB |
| ethoxyquin | Alan Wood's Pesticides |
| FDB019147 | FooDB |
| Citations |
|---|