EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO |
| Net Charge | 0 |
| Average Mass | 217.312 |
| Monoisotopic Mass | 217.14666 |
| SMILES | CCOc1ccc2c(c1)C(C)=CC(C)(C)N2 |
| InChI | InChI=1S/C14H19NO/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-9,15H,5H2,1-4H3 |
| InChIKey | DECIPOUIJURFOJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. |
| Biological Roles: | UDP-glucuronosyltransferase activator Any compound that activates UDP-glucuronosyltransferase (EC 2.4.1.17). food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. Hsp90 inhibitor An EC 3.6.4.10 (non-chaperonin molecular chaperone ATPase) inhibitor that blocks the action of heat shock protein 90. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| Applications: | neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. food antioxidant An antioxidant that used as a food additives to help guard against food deterioration. herbicide A substance used to destroy plant pests. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antifungal agrochemical Any substance used in acriculture, horticulture, forestry, etc. for its fungicidal properties. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ethoxyquin (CHEBI:77323) has role antifungal agrochemical (CHEBI:86328) |
| ethoxyquin (CHEBI:77323) has role food antioxidant (CHEBI:77962) |
| ethoxyquin (CHEBI:77323) has role genotoxin (CHEBI:50902) |
| ethoxyquin (CHEBI:77323) has role geroprotector (CHEBI:176497) |
| ethoxyquin (CHEBI:77323) has role herbicide (CHEBI:24527) |
| ethoxyquin (CHEBI:77323) has role Hsp90 inhibitor (CHEBI:63962) |
| ethoxyquin (CHEBI:77323) has role neuroprotective agent (CHEBI:63726) |
| ethoxyquin (CHEBI:77323) has role UDP-glucuronosyltransferase activator (CHEBI:77324) |
| ethoxyquin (CHEBI:77323) is a aromatic ether (CHEBI:35618) |
| ethoxyquin (CHEBI:77323) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| 6-ethoxy-2,2,4-trimethyl-1,2-dihydroquinoline |
| Synonyms | Source |
|---|---|
| 1,2-Dihydro-2,2,4-trimethyl-6-ethoxyquinoline | NIST Chemistry WebBook |
| 1,2-dihydro-2,2,4-trimethyl-6-quinolyl ethyl ether | Alan Wood's Pesticides |
| 1,2-Dihydro-6-ethoxy-2,2,4-trimethylquinoline | HMDB |
| 2,2,4-Trimethyl-6-ethoxy-1,2-dihydroquinoline | ChemIDplus |
| 6-Ethoxy-1,2-dihydro-2,2,4-trimethylquinoline | HMDB |
| E 324 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 280 | PPDB |
| 280 | VSDB |
| ethoxyquin | Alan Wood's Pesticides |
| Ethoxyquin | Wikipedia |
| FDB019147 | FooDB |
| HMDB0039531 | HMDB |
| LSM-5670 | LINCS |
| WO2011028128 | Patent |
| Citations |
|---|