EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H7NO6 |
| Net Charge | 0 |
| Average Mass | 273.200 |
| Monoisotopic Mass | 273.02734 |
| SMILES | O=c1c2c(O)cccc2oc2c([N+](=O)[O-])ccc(O)c12 |
| InChI | InChI=1S/C13H7NO6/c15-7-2-1-3-9-10(7)12(17)11-8(16)5-4-6(14(18)19)13(11)20-9/h1-5,15-16H |
| InChIKey | ZOHCDJRFYXKEQW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,8-dihydroxy-4-nitroxanthen-9-one (CHEBI:77321) has role protein kinase inhibitor (CHEBI:37699) |
| 1,8-dihydroxy-4-nitroxanthen-9-one (CHEBI:77321) is a C-nitro compound (CHEBI:35716) |
| 1,8-dihydroxy-4-nitroxanthen-9-one (CHEBI:77321) is a polyphenol (CHEBI:26195) |
| 1,8-dihydroxy-4-nitroxanthen-9-one (CHEBI:77321) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 1,8-dihydroxy-4-nitro-9H-xanthen-9-one |
| Synonym | Source |
|---|---|
| MNX | ChEBI |
| Citations |
|---|