EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H6N2S3 |
| Net Charge | 0 |
| Average Mass | 226.351 |
| Monoisotopic Mass | 225.96931 |
| SMILES | Cc1c(-c2cnccn2)ssc1=S |
| InChI | InChI=1S/C8H6N2S3/c1-5-7(12-13-8(5)11)6-4-9-2-3-10-6/h2-4H,1H3 |
| InChIKey | CKNAQFVBEHDJQV-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | antimutagen An agent that reduces or interferes with the mutagenic actions or effects of a substance. neurotoxin A poison that interferes with the functions of the nervous system. EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor An EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor which interferes with the activity of the enzyme protein tyrosine phosphatases (PTPs), EC 3.1.3.48, involved in the removal of phosphate groups from phosphorylated tyrosine residues on proteins. |
| Applications: | angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. protective agent Synthetic or natural substance which is given to prevent a disease or disorder or are used in the process of treating a disease or injury due to a poisonous agent. schistosomicide drug Drugs that used to treat infestations by flukes (trematodes) of the genus Schistosoma. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| oltipraz (CHEBI:77319) has role angiogenesis modulating agent (CHEBI:50926) |
| oltipraz (CHEBI:77319) has role antimutagen (CHEBI:73190) |
| oltipraz (CHEBI:77319) has role antineoplastic agent (CHEBI:35610) |
| oltipraz (CHEBI:77319) has role antioxidant (CHEBI:22586) |
| oltipraz (CHEBI:77319) has role EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor (CHEBI:35608) |
| oltipraz (CHEBI:77319) has role neurotoxin (CHEBI:50910) |
| oltipraz (CHEBI:77319) has role protective agent (CHEBI:50267) |
| oltipraz (CHEBI:77319) has role schistosomicide drug (CHEBI:38941) |
| oltipraz (CHEBI:77319) is a 1,2-dithiole (CHEBI:48859) |
| oltipraz (CHEBI:77319) is a pyrazines (CHEBI:38314) |
| IUPAC Name |
|---|
| 4-methyl-5-(pyrazin-2-yl)-3H-1,2-dithiole-3-thione |
| INNs | Source |
|---|---|
| oltipraz | WHO MedNet |
| oltipraz | WHO MedNet |
| oltipraz | ChemIDplus |
| oltiprazum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 4-Methyl-5-pyrazinyl-3H-1,2-dithiole-3-thione | ChemIDplus |
| 5-(2-Pyrazinyl)-4-methyl-1,2-dithiole-3-thione | ChemIDplus |
| RP 35972 | ChemIDplus |
| RP-35,972 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| HMDB0041967 | HMDB |
| Oltipraz | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:978110 | Reaxys |
| CAS:64224-21-1 | ChemIDplus |
| Citations |
|---|