EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H18O5 |
| Net Charge | 0 |
| Average Mass | 302.326 |
| Monoisotopic Mass | 302.11542 |
| SMILES | COc1ccc(CC(O)C(=O)c2ccc(OC)cc2O)cc1 |
| InChI | InChI=1S/C17H18O5/c1-21-12-5-3-11(4-6-12)9-16(19)17(20)14-8-7-13(22-2)10-15(14)18/h3-8,10,16,18-19H,9H2,1-2H3 |
| InChIKey | PPOABILDHKLUET-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lathyrus odoratus (ncbitaxon:3859) | - | DOI (10.1016/S0031-9422(00)80519-1) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| odoratol (CHEBI:7729) has role plant metabolite (CHEBI:76924) |
| odoratol (CHEBI:7729) is a dihydrochalcones (CHEBI:71230) |
| odoratol (CHEBI:7729) is a diol (CHEBI:23824) |
| odoratol (CHEBI:7729) is a monomethoxybenzene (CHEBI:25235) |
| odoratol (CHEBI:7729) is a phenols (CHEBI:33853) |
| odoratol (CHEBI:7729) is a secondary α-hydroxy ketone (CHEBI:2468) |
| Incoming Relation(s) |
| 2'-O-methylodoratol (CHEBI:847) has functional parent odoratol (CHEBI:7729) |
| IUPAC Name |
|---|
| 2-hydroxy-1-(2-hydroxy-4-methoxyphenyl)-3-(4-methoxyphenyl)propan-1-one |
| Synonym | Source |
|---|---|
| α,2'-dihydroxy-4,4'-dimethoxydihydrochalcone | ChEBI |