EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12O8S |
| Net Charge | 0 |
| Average Mass | 244.221 |
| Monoisotopic Mass | 244.02529 |
| SMILES | O=S(=O)(O)C[C@H]1OC(O)(CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C6H12O8S/c7-2-6(10)5(9)4(8)3(14-6)1-15(11,12)13/h3-5,7-10H,1-2H2,(H,11,12,13)/t3-,4-,5+,6?/m1/s1 |
| InChIKey | QTQNAYQDKCBJTC-VRPWFDPXSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-deoxy-6-sulfo-D-fructofuranose (CHEBI:77261) has functional parent D-fructofuranose (CHEBI:37721) |
| 6-deoxy-6-sulfo-D-fructofuranose (CHEBI:77261) has role metabolite (CHEBI:25212) |
| 6-deoxy-6-sulfo-D-fructofuranose (CHEBI:77261) is a carbohydrate sulfonate (CHEBI:38029) |
| 6-deoxy-6-sulfo-D-fructofuranose (CHEBI:77261) is conjugate acid of 6-deoxy-6-sulfo-D-fructofuranose(1−) (CHEBI:77133) |
| Incoming Relation(s) |
| 6-deoxy-6-sulfo-D-fructofuranose(1−) (CHEBI:77133) is conjugate base of 6-deoxy-6-sulfo-D-fructofuranose (CHEBI:77261) |
| IUPAC Name |
|---|
| 6-deoxy-6-sulfo-D-fructofuranose |
| Synonyms | Source |
|---|---|
| 6-deoxy-6-sulfofructose | MetaCyc |
| 6-deoxy-6-sulphofructose | MetaCyc |
| 6-sulfofructose | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-16501 | MetaCyc |
| Citations |
|---|