EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H66N10O10S2 |
| Net Charge | 0 |
| Average Mass | 1019.261 |
| Monoisotopic Mass | 1018.44048 |
| SMILES | [H][C@@]1([C@@H](C)O)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](Cc2cnc3ccccc23)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](NC(=O)[C@H](N)Cc2ccccc2)CSSC[C@@H](C(=O)NC(CO)[C@@H](C)O)NC1=O |
| InChI | InChI=1S/C49H66N10O10S2/c1-28(61)39(25-60)56-48(68)41-27-71-70-26-40(57-43(63)34(51)21-30-13-5-3-6-14-30)47(67)54-37(22-31-15-7-4-8-16-31)45(65)55-38(23-32-24-52-35-18-10-9-17-33(32)35)46(66)53-36(19-11-12-20-50)44(64)59-42(29(2)62)49(69)58-41/h3-10,13-18,24,28-29,34,36-42,52,60-62H,11-12,19-23,25-27,50-51H2,1-2H3,(H,53,66)(H,54,67)(H,55,65)(H,56,68)(H,57,63)(H,58,69)(H,59,64)/t28-,29-,34-,36+,37+,38-,39?,40+,41+,42+/m1/s1 |
| InChIKey | DEQANNDTNATYII-FLDZURHUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | hormone agonist A chemical substance which binds to specific hormone receptors activating the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. |
| Application: | hormone agonist A chemical substance which binds to specific hormone receptors activating the function of the endocrine glands, the biosynthesis of their secreted hormones, or the action of hormones upon their specific sites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| octreotide (CHEBI:7726) has role hormone agonist (CHEBI:51060) |
| octreotide (CHEBI:7726) is a homodetic cyclic peptide (CHEBI:24613) |
| INNs | Source |
|---|---|
| octreotida | ChEBI |
| octreotide | ChEBI |
| octréotide | ChEBI |
| octreotidum | ChEBI |
| Synonyms | Source |
|---|---|
| D-Phenylalanyl-L-cysteinyl-L-phenylalanyl-D-tryptophyl-L-lysyl-L- threonyl-N-((1R,2R)-2-hydroxy-1-(hydroxymethyl)propyl)-L- cysteinamide cyclic (2->7)-disulfide | KEGG COMPOUND |
| Longastatin | ChemIDplus |
| Octreotide | KEGG COMPOUND |
| octreotide acetate | DrugCentral |
| sandostatine | DrugCentral |
| D-phenylalanyl-L-cysteinyl-L-phenylalanyl-D-tryptophyl-L-lysyl-L-threonyl-N-[(1R,2R)-2-hydroxy-1-(hydroxymethyl)propyl]-L-cysteinamide cyclic (2→7)-disulfide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 1980 | DrugCentral |
| 1SOC | PDB |
| C07306 | KEGG COMPOUND |
| D00442 | KEGG DRUG |
| DB00104 | DrugBank |
| EP29579 | Patent |
| HMDB0014262 | HMDB |
| Octreotide | Wikipedia |
| US4395403 | Patent |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7246145 | Beilstein |
| CAS:83150-76-9 | KEGG COMPOUND |
| CAS:83150-76-9 | ChemIDplus |