EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H67NO8 |
| Net Charge | 0 |
| Average Mass | 677.964 |
| Monoisotopic Mass | 677.48667 |
| SMILES | CCCCCCCCCCCCCC[C@@H](O)[C@@H](O)[C@H](/C=C/[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)NC(=O)CCCCCCCc1ccccc1 |
| InChI | InChI=1S/C39H67NO8/c1-2-3-4-5-6-7-8-9-10-11-14-20-25-32(42)36(44)31(27-28-33-37(45)39(47)38(46)34(29-41)48-33)40-35(43)26-21-15-12-13-17-22-30-23-18-16-19-24-30/h16,18-19,23-24,27-28,31-34,36-39,41-42,44-47H,2-15,17,20-22,25-26,29H2,1H3,(H,40,43)/b28-27+/t31-,32+,33+,34+,36-,37-,38-,39+/m0/s1 |
| InChIKey | RWGUVAAXYHWJFZ-CSYYKWSVSA-N |
| Roles Classification |
|---|
| Biological Role: | ceramide allergen Any ceramide which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GCK152 (CHEBI:77171) has role ceramide allergen (CHEBI:143252) |
| GCK152 (CHEBI:77171) is a C-glycosylphytoceramide (CHEBI:60910) |
| IUPAC Name |
|---|
| (1R)-1,5-anhydro-1-{(1E,3S,4S,5R)-4,5-dihydroxy-3-[(8-phenyloctanoyl)amino]nonadec-1-en-1-yl}-D-galactitol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13041123 | Reaxys |
| Citations |
|---|