EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C53H90O22 |
| Net Charge | 0 |
| Average Mass | 1079.281 |
| Monoisotopic Mass | 1078.59237 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@](C)(CCC=C(C)C)O[C@@H]4O[C@H](CO[C@@H]5OC[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@]21C |
| InChI | InChI=1S/C53H90O22/c1-23(2)10-9-14-53(8,75-47-43(67)39(63)37(61)29(72-47)22-69-45-41(65)34(58)26(57)21-68-45)24-11-16-52(7)33(24)25(56)18-31-50(5)15-13-32(49(3,4)30(50)12-17-51(31,52)6)73-48-44(40(64)36(60)28(20-55)71-48)74-46-42(66)38(62)35(59)27(19-54)70-46/h10,24-48,54-67H,9,11-22H2,1-8H3/t24-,25+,26+,27+,28+,29+,30-,31+,32-,33-,34-,35+,36+,37+,38-,39-,40-,41+,42+,43+,44+,45-,46-,47-,48-,50-,51+,52+,53-/m0/s1 |
| InChIKey | NODILNFGTFIURN-USYOXQFSSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | NMDA receptor antagonist Any substance that inhibits the action of N-methyl-D-aspartate (NMDA) receptors. They tend to induce a state known as dissociative anesthesia, marked by catalepsy, amnesia, and analgesia, while side effects can include hallucinations, nightmares, and confusion. Due to their psychotomimetic effects, many NMDA receptor antagonists are used as recreational drugs. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ginsenoside Rb3 (CHEBI:77153) has parent hydride dammarane (CHEBI:36488) |
| ginsenoside Rb3 (CHEBI:77153) has role antidepressant (CHEBI:35469) |
| ginsenoside Rb3 (CHEBI:77153) has role antioxidant (CHEBI:22586) |
| ginsenoside Rb3 (CHEBI:77153) has role cardioprotective agent (CHEBI:77307) |
| ginsenoside Rb3 (CHEBI:77153) has role neuroprotective agent (CHEBI:63726) |
| ginsenoside Rb3 (CHEBI:77153) has role NMDA receptor antagonist (CHEBI:60643) |
| ginsenoside Rb3 (CHEBI:77153) has role plant metabolite (CHEBI:76924) |
| ginsenoside Rb3 (CHEBI:77153) is a 12β-hydroxy steroid (CHEBI:36847) |
| ginsenoside Rb3 (CHEBI:77153) is a disaccharide derivative (CHEBI:63353) |
| ginsenoside Rb3 (CHEBI:77153) is a ginsenoside (CHEBI:74978) |
| ginsenoside Rb3 (CHEBI:77153) is a tetracyclic triterpenoid (CHEBI:26893) |
| ginsenoside Rb3 (CHEBI:77153) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β,12β)-20-{[6-O-(β-D-xylopyranosyl)-β-D-glucopyranosyl]oxy}-12-hydroxydammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside |
| UniProt Name | Source |
|---|---|
| ginsenoside Rb3 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CN101390887 | Patent |
| CN101856365 | Patent |
| CPD-15453 | MetaCyc |
| KR20120001996 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5724307 | Reaxys |
| CAS:68406-26-8 | ChemIDplus |
| Citations |
|---|