EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C48H82O18 |
| Net Charge | 0 |
| Average Mass | 947.166 |
| Monoisotopic Mass | 946.55012 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@](C)(CCC=C(C)C)O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)CC[C@@]3(C)[C@]1(C)C[C@H](O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@@H](C)[C@H](O)[C@@H](O)[C@H]1O)[C@@]1([H])C(C)(C)[C@@H](O)CC[C@]21C |
| InChI | InChI=1S/C48H82O18/c1-21(2)11-10-14-48(9,66-42-38(60)35(57)32(54)26(19-49)63-42)23-12-16-46(7)30(23)24(51)17-28-45(6)15-13-29(52)44(4,5)40(45)25(18-47(28,46)8)62-43-39(36(58)33(55)27(20-50)64-43)65-41-37(59)34(56)31(53)22(3)61-41/h11,22-43,49-60H,10,12-20H2,1-9H3/t22-,23-,24+,25-,26+,27+,28+,29-,30-,31-,32+,33+,34+,35-,36-,37+,38+,39+,40-,41-,42-,43+,45+,46+,47+,48-/m0/s1 |
| InChIKey | PWAOOJDMFUQOKB-WCZZMFLVSA-N |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. nephroprotective agent Any protective agent that is able to prevent damage to the kidney. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ginsenoside Re (CHEBI:77148) has parent hydride dammarane (CHEBI:36488) |
| ginsenoside Re (CHEBI:77148) has role anti-inflammatory agent (CHEBI:67079) |
| ginsenoside Re (CHEBI:77148) has role antineoplastic agent (CHEBI:35610) |
| ginsenoside Re (CHEBI:77148) has role antioxidant (CHEBI:22586) |
| ginsenoside Re (CHEBI:77148) has role nephroprotective agent (CHEBI:76595) |
| ginsenoside Re (CHEBI:77148) has role neuroprotective agent (CHEBI:63726) |
| ginsenoside Re (CHEBI:77148) has role plant metabolite (CHEBI:76924) |
| ginsenoside Re (CHEBI:77148) is a 12β-hydroxy steroid (CHEBI:36847) |
| ginsenoside Re (CHEBI:77148) is a 3β-hydroxy steroid (CHEBI:36836) |
| ginsenoside Re (CHEBI:77148) is a 3β-hydroxy-4,4-dimethylsteroid (CHEBI:143563) |
| ginsenoside Re (CHEBI:77148) is a disaccharide derivative (CHEBI:63353) |
| ginsenoside Re (CHEBI:77148) is a ginsenoside (CHEBI:74978) |
| ginsenoside Re (CHEBI:77148) is a tetracyclic triterpenoid (CHEBI:26893) |
| ginsenoside Re (CHEBI:77148) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Names |
|---|
| (3β,6α,12β)-20-(β-D-glucopyranosyloxy)-3,12-dihydroxydammar-24-en-6-yl 2-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranoside |
| (3β,6α,12β)-20-(β-D-glucopyranosyloxy)-3,12-dihydroxydammar-24-en-6-yl 2-O-(α-L-rhamnopyranosyl)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| Chikusetsusaponin IVc | ChemIDplus |
| Ginsenoside B2 | ChemIDplus |
| NSC 308877 | ChemIDplus |
| Panaxoside RE | ChemIDplus |
| UniProt Name | Source |
|---|---|
| (20S)-ginsenoside Re | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C00003518 | KNApSAcK |
| C08944 | KEGG COMPOUND |
| CPD-15442 | MetaCyc |
| WO2006001654 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5723316 | Reaxys |
| CAS:52286-59-6 | KEGG COMPOUND |
| CAS:52286-59-6 | ChemIDplus |
| Citations |
|---|