EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H62O8 |
| Net Charge | 0 |
| Average Mass | 622.884 |
| Monoisotopic Mass | 622.44447 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@@](C)(O)CCC=C(C)C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@]21C |
| InChI | InChI=1S/C36H62O8/c1-20(2)10-9-14-36(8,42)21-11-16-35(7)27(21)22(38)18-25-33(5)15-13-26(32(3,4)24(33)12-17-34(25,35)6)44-31-30(41)29(40)28(39)23(19-37)43-31/h10,21-31,37-42H,9,11-19H2,1-8H3/t21-,22+,23+,24-,25+,26-,27-,28+,29-,30+,31-,33-,34+,35+,36-/m0/s1 |
| InChIKey | CKUVNOCSBYYHIS-IRFFNABBSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. hepatoprotective agent Any compound that is able to prevent damage to the liver. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has parent hydride dammarane (CHEBI:36488) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has role antineoplastic agent (CHEBI:35610) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has role apoptosis inducer (CHEBI:68495) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has role bone density conservation agent (CHEBI:50646) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has role cardioprotective agent (CHEBI:77307) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has role hepatoprotective agent (CHEBI:62868) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has role plant metabolite (CHEBI:76924) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) is a 12β-hydroxy steroid (CHEBI:36847) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) is a 20-hydroxy steroid (CHEBI:36854) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) is a ginsenoside (CHEBI:74978) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) is a tetracyclic triterpenoid (CHEBI:26893) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β,12β)-12,20-dihydroxydammar-24-en-3-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 3β-(β-D-glucopyranosyloxy)dammar-24-ene-3β,20β-diol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (20S)-ginsenoside Rh2 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12104 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4895638 | Reaxys |
| CAS:78214-33-2 | ChemIDplus |
| Citations |
|---|