EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H62O8 |
| Net Charge | 0 |
| Average Mass | 622.884 |
| Monoisotopic Mass | 622.44447 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@@](C)(O)CCC=C(C)C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@]21C |
| InChI | InChI=1S/C36H62O8/c1-20(2)10-9-14-36(8,42)21-11-16-35(7)27(21)22(38)18-25-33(5)15-13-26(32(3,4)24(33)12-17-34(25,35)6)44-31-30(41)29(40)28(39)23(19-37)43-31/h10,21-31,37-42H,9,11-19H2,1-8H3/t21-,22+,23+,24-,25+,26-,27-,28+,29-,30+,31-,33-,34+,35+,36-/m0/s1 |
| InChIKey | CKUVNOCSBYYHIS-IRFFNABBSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hepatoprotective agent Any compound that is able to prevent damage to the liver. bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has parent hydride dammarane (CHEBI:36488) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has role antineoplastic agent (CHEBI:35610) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has role apoptosis inducer (CHEBI:68495) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has role bone density conservation agent (CHEBI:50646) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has role cardioprotective agent (CHEBI:77307) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has role hepatoprotective agent (CHEBI:62868) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) has role plant metabolite (CHEBI:76924) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) is a 12β-hydroxy steroid (CHEBI:36847) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) is a 20-hydroxy steroid (CHEBI:36854) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) is a ginsenoside (CHEBI:74978) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) is a tetracyclic triterpenoid (CHEBI:26893) |
| (20S)-ginsenoside Rh2 (CHEBI:77147) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β,12β)-12,20-dihydroxydammar-24-en-3-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 3β-(β-D-glucopyranosyloxy)dammar-24-ene-3β,20β-diol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (20S)-ginsenoside Rh2 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12104 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4895638 | Reaxys |
| CAS:78214-33-2 | ChemIDplus |
| Citations |
|---|