EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H72O13 |
| Net Charge | 0 |
| Average Mass | 785.025 |
| Monoisotopic Mass | 784.49729 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@](C)(CCC=C(C)C)O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@]21C |
| InChI | InChI=1S/C42H72O13/c1-21(2)10-9-14-42(8,55-37-35(51)33(49)31(47)25(20-44)53-37)22-11-16-41(7)29(22)23(45)18-27-39(5)15-13-28(38(3,4)26(39)12-17-40(27,41)6)54-36-34(50)32(48)30(46)24(19-43)52-36/h10,22-37,43-51H,9,11-20H2,1-8H3/t22-,23+,24+,25+,26-,27+,28-,29-,30+,31+,32-,33-,34+,35+,36-,37-,39-,40+,41+,42-/m0/s1 |
| InChIKey | SWIROVJVGRGSPO-JBVRGBGGSA-N |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ginsenoside F2 (CHEBI:77145) has parent hydride dammarane (CHEBI:36488) |
| ginsenoside F2 (CHEBI:77145) has role antineoplastic agent (CHEBI:35610) |
| ginsenoside F2 (CHEBI:77145) has role apoptosis inducer (CHEBI:68495) |
| ginsenoside F2 (CHEBI:77145) has role plant metabolite (CHEBI:76924) |
| ginsenoside F2 (CHEBI:77145) is a 12β-hydroxy steroid (CHEBI:36847) |
| ginsenoside F2 (CHEBI:77145) is a ginsenoside (CHEBI:74978) |
| ginsenoside F2 (CHEBI:77145) is a tetracyclic triterpenoid (CHEBI:26893) |
| ginsenoside F2 (CHEBI:77145) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β,12β)-20-(β-D-glucopyranosyloxy)-12-hydroxydammar-24-en-3-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 3β,20-bis(β-D-glucopyranosyloxy)dammar-24-en-12β-ol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (20S)-ginsenoside F2 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12100 | MetaCyc |
| HMDB0039545 | HMDB |
| KR20090061107 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5720814 | Reaxys |
| CAS:62025-49-4 | HMDB |
| Citations |
|---|