EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H72O13 |
| Net Charge | 0 |
| Average Mass | 785.025 |
| Monoisotopic Mass | 784.49729 |
| SMILES | [H][C@]12C[C@@H](O)[C@]3([H])[C@@]([H])([C@](C)(CCC=C(C)C)O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)CC[C@]21C |
| InChI | InChI=1S/C42H72O13/c1-21(2)10-9-14-42(8,55-37-35(51)33(49)31(47)25(20-44)53-37)22-11-16-41(7)29(22)23(45)18-27-39(5)15-13-28(38(3,4)26(39)12-17-40(27,41)6)54-36-34(50)32(48)30(46)24(19-43)52-36/h10,22-37,43-51H,9,11-20H2,1-8H3/t22-,23+,24+,25+,26-,27+,28-,29-,30+,31+,32-,33-,34+,35+,36-,37-,39-,40+,41+,42-/m0/s1 |
| InChIKey | SWIROVJVGRGSPO-JBVRGBGGSA-N |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ginsenoside F2 (CHEBI:77145) has parent hydride dammarane (CHEBI:36488) |
| ginsenoside F2 (CHEBI:77145) has role antineoplastic agent (CHEBI:35610) |
| ginsenoside F2 (CHEBI:77145) has role apoptosis inducer (CHEBI:68495) |
| ginsenoside F2 (CHEBI:77145) has role plant metabolite (CHEBI:76924) |
| ginsenoside F2 (CHEBI:77145) is a 12β-hydroxy steroid (CHEBI:36847) |
| ginsenoside F2 (CHEBI:77145) is a ginsenoside (CHEBI:74978) |
| ginsenoside F2 (CHEBI:77145) is a tetracyclic triterpenoid (CHEBI:26893) |
| ginsenoside F2 (CHEBI:77145) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| (3β,12β)-20-(β-D-glucopyranosyloxy)-12-hydroxydammar-24-en-3-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 3β,20-bis(β-D-glucopyranosyloxy)dammar-24-en-12β-ol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| (20S)-ginsenoside F2 | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12100 | MetaCyc |
| HMDB0039545 | HMDB |
| KR20090061107 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5720814 | Reaxys |
| CAS:62025-49-4 | HMDB |
| Citations |
|---|