EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30N3O13P2 |
| Net Charge | -1 |
| Average Mass | 558.394 |
| Monoisotopic Mass | 558.12593 |
| SMILES | CO[C@H]1[C@H](C)O[C@H](OP(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H](n3cc(C)c(=O)nc3=O)C[C@@H]2O)C[C@]1(C)[NH3+] |
| InChI | InChI=1S/C18H31N3O13P2/c1-9-7-21(17(24)20-16(9)23)13-5-11(22)12(32-13)8-30-35(25,26)34-36(27,28)33-14-6-18(3,19)15(29-4)10(2)31-14/h7,10-15,22H,5-6,8,19H2,1-4H3,(H,25,26)(H,27,28)(H,20,23,24)/p-1/t10-,11-,12+,13+,14+,15-,18-/m0/s1 |
| InChIKey | QEQCMOGEDCECSI-JGQKHYKVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dTDP-β-L-evernosamine(1−) (CHEBI:77144) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| dTDP-β-L-evernosamine(1−) (CHEBI:77144) is conjugate base of dTDP-β-L-evernosamine (CHEBI:77285) |
| Incoming Relation(s) |
| dTDP-β-L-evernosamine (CHEBI:77285) is conjugate acid of dTDP-β-L-evernosamine(1−) (CHEBI:77144) |
| UniProt Name | Source |
|---|---|
| dTDP-β-L-evernosamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16433 | MetaCyc |
| Citations |
|---|