EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H29N3O14P2 |
| Net Charge | -2 |
| Average Mass | 573.385 |
| Monoisotopic Mass | 573.11357 |
| SMILES | CO[C@H]1[C@H](C)O[C@H](OP(=O)([O-])OP(=O)([O-])OC[C@H]2O[C@@H](n3cc(C)c(=O)nc3=O)C[C@@H]2O)C[C@]1(C)NO |
| InChI | InChI=1S/C18H31N3O14P2/c1-9-7-21(17(24)19-16(9)23)13-5-11(22)12(33-13)8-31-36(26,27)35-37(28,29)34-14-6-18(3,20-25)15(30-4)10(2)32-14/h7,10-15,20,22,25H,5-6,8H2,1-4H3,(H,26,27)(H,28,29)(H,19,23,24)/p-2/t10-,11-,12+,13+,14+,15-,18-/m0/s1 |
| InChIKey | SNTNNQMUKUWPMM-JGQKHYKVSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dTDP-N-hydroxy-β-L-evernosamine(2−) (CHEBI:77143) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| dTDP-N-hydroxy-β-L-evernosamine(2−) (CHEBI:77143) is conjugate base of dTDP-N-hydroxy-β-L-evernosamine (CHEBI:77281) |
| Incoming Relation(s) |
| dTDP-N-hydroxy-β-L-evernosamine (CHEBI:77281) is conjugate acid of dTDP-N-hydroxy-β-L-evernosamine(2−) (CHEBI:77143) |
| UniProt Name | Source |
|---|---|
| dTDP-N-hydroxy-β-L-evernosamine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-16426 | MetaCyc |
| Citations |
|---|