EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H72O5 |
| Net Charge | 0 |
| Average Mass | 669.044 |
| Monoisotopic Mass | 668.53798 |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O[C@@H](CO)COC(=O)CCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C43H72O5/c1-3-5-7-9-11-13-15-17-19-20-21-22-24-26-28-30-32-34-36-38-43(46)48-41(39-44)40-47-42(45)37-35-33-31-29-27-25-23-18-16-14-12-10-8-6-4-2/h5,7,11,13,17,19,21-22,26,28,32,34,41,44H,3-4,6,8-10,12,14-16,18,20,23-25,27,29-31,33,35-40H2,1-2H3/b7-5-,13-11-,19-17-,22-21-,28-26-,34-32-/t41-/m0/s1 |
| InChIKey | LBDXVTOFXXDOGH-KXYFHQNYSA-N |
| Roles Classification |
|---|
| Biological Roles: | protein kinase C agonist An agonist that selectively binds to and activates a protein kinase C receptor calcium channel agonist Agents that increase calcium influx into calcium channels of excitable tissues. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-stearoyl-2-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-sn-glycerol (CHEBI:77129) has functional parent all-cis-docosa-4,7,10,13,16,19-hexaenoic acid (CHEBI:28125) |
| 1-stearoyl-2-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-sn-glycerol (CHEBI:77129) has functional parent octadecanoic acid (CHEBI:28842) |
| 1-stearoyl-2-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-sn-glycerol (CHEBI:77129) has role calcium channel agonist (CHEBI:38807) |
| 1-stearoyl-2-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-sn-glycerol (CHEBI:77129) has role protein kinase C agonist (CHEBI:64018) |
| 1-stearoyl-2-(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-sn-glycerol (CHEBI:77129) is a 1,2-diacyl-sn-glycerol (CHEBI:17815) |
| IUPAC Name |
|---|
| (2S)-1-hydroxy-3-(octadecanoyloxy)propan-2-yl (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| Synonyms | Source |
|---|---|
| DAG 18:0/22:6(ω-3)/0:0 | SUBMITTER |
| DG(18:0/22:6(4Z,7Z,10Z,13Z,16Z,19Z)/0:0) | LIPID MAPS |
| DG(18:0/22:6/0:0) | LIPID MAPS |
| 1-octadecanoyl-2-(4Z,7Z,10Z,13Z,16Z,19Z-docosahexaenoyl)-sn-glycerol | LIPID MAPS |
| 1-Stearoyl-2-docosahexaenoyl-sn-glycerol | HMDB |
| DG(18:0/22:6) | HMDB |
| UniProt Name | Source |
|---|---|
| 1-octadecanoyl-2-(4Z,7Z,10Z,13Z,16Z,19Z-docosahexaenoyl)-sn-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| LMGL02010216 | LIPID MAPS |
| HMDB0007179 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7612274 | Reaxys |
| Citations |
|---|