EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H68O5 |
| Net Charge | 0 |
| Average Mass | 616.968 |
| Monoisotopic Mass | 616.50668 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C39H68O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,37,40H,3-10,15-16,21-36H2,1-2H3/b13-11-,14-12-,19-17-,20-18-/t37-/m0/s1 |
| InChIKey | MQGBAQLIFKSMEM-ZHARMHCNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | MetaboLights (MTBLS143) |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,2-dilinoleoyl-sn-glycerol (CHEBI:77127) has functional parent linoleic acid (CHEBI:17351) |
| 1,2-dilinoleoyl-sn-glycerol (CHEBI:77127) has role mouse metabolite (CHEBI:75771) |
| 1,2-dilinoleoyl-sn-glycerol (CHEBI:77127) is a 1,2-diacyl-sn-glycerol (CHEBI:17815) |
| 1,2-dilinoleoyl-sn-glycerol (CHEBI:77127) is a dilinoleoylglycerol (CHEBI:138658) |
| 1,2-dilinoleoyl-sn-glycerol (CHEBI:77127) is enantiomer of 2,3-dilinoleoyl-sn-glycerol (CHEBI:75854) |
| Incoming Relation(s) |
| 2,3-dilinoleoyl-sn-glycerol (CHEBI:75854) is enantiomer of 1,2-dilinoleoyl-sn-glycerol (CHEBI:77127) |
| IUPAC Name |
|---|
| (2S)-3-hydroxypropane-1,2-diyl (9Z,12Z,9'Z,12'Z)bis-octadeca-9,12-dienoate |
| Synonyms | Source |
|---|---|
| 1,2-di-(9Z,12Z-octadecadienoyl)-sn-glycerol | LIPID MAPS |
| DAG(18:2/18:2) | HMDB |
| DAG(18:2n6/18:2n6) | HMDB |
| DAG(18:2ω6/18:2ω6) | HMDB |
| DAG 18:2(ω-6)/18:2(ω-6)/0:0 | SUBMITTER |
| DAG(36:4) | HMDB |
| UniProt Name | Source |
|---|---|
| 1,2-di-(9Z,12Z-octadecadienoyl)-sn-glycerol | UniProt |
| Manual Xrefs | Databases |
|---|---|
| HMDB0007248 | HMDB |
| LMGL02010063 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5319744 | Reaxys |
| CAS:24529-89-3 | ChemIDplus |