EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H8O5 |
| Net Charge | 0 |
| Average Mass | 208.169 |
| Monoisotopic Mass | 208.03717 |
| SMILES | C=C(Oc1cccc(C(=O)O)c1)C(=O)O |
| InChI | InChI=1S/C10H8O5/c1-6(9(11)12)15-8-4-2-3-7(5-8)10(13)14/h2-5H,1H2,(H,11,12)(H,13,14) |
| InChIKey | HGVAHYJMDVROLE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-[(1-carboxyvinyl)oxy]benzoic acid (CHEBI:77107) has functional parent acrylic acid (CHEBI:18308) |
| 3-[(1-carboxyvinyl)oxy]benzoic acid (CHEBI:77107) is a aromatic ether (CHEBI:35618) |
| 3-[(1-carboxyvinyl)oxy]benzoic acid (CHEBI:77107) is a benzoic acids (CHEBI:22723) |
| 3-[(1-carboxyvinyl)oxy]benzoic acid (CHEBI:77107) is a dicarboxylic acid (CHEBI:35692) |
| 3-[(1-carboxyvinyl)oxy]benzoic acid (CHEBI:77107) is a enol ether (CHEBI:47985) |
| 3-[(1-carboxyvinyl)oxy]benzoic acid (CHEBI:77107) is conjugate acid of 3-[(1-carboxylatovinyl)oxy]benzoate(2−) (CHEBI:76981) |
| Incoming Relation(s) |
| 3-[(1-carboxylatovinyl)oxy]benzoate(2−) (CHEBI:76981) is conjugate base of 3-[(1-carboxyvinyl)oxy]benzoic acid (CHEBI:77107) |
| Synonym | Source |
|---|---|
| 3-[(1-carboxyvinyl)oxy]benzoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2373061 | Reaxys |
| Citations |
|---|