EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H23N3O11 |
| Net Charge | 0 |
| Average Mass | 433.370 |
| Monoisotopic Mass | 433.13326 |
| SMILES | CC(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H23N3O11/c1-7(20)17-10(6-13(25)26)15(28)18-8(2-4-11(21)22)14(27)19-9(16(29)30)3-5-12(23)24/h8-10H,2-6H2,1H3,(H,17,20)(H,18,28)(H,19,27)(H,21,22)(H,23,24)(H,25,26)(H,29,30)/t8-,9-,10-/m0/s1 |
| InChIKey | XNHNFLZMOUNVIW-GUBZILKMSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ac-Asp-Glu-Glu (CHEBI:77064) is a tripeptide (CHEBI:47923) |
| Ac-Asp-Glu-Glu (CHEBI:77064) is conjugate acid of Ac-Asp-Glu-Glu(4−) (CHEBI:76935) |
| Incoming Relation(s) |
| Ac-Asp-Glu-Glu(4−) (CHEBI:76935) is conjugate base of Ac-Asp-Glu-Glu (CHEBI:77064) |
| IUPAC Name |
|---|
| N-acetyl-L-α-aspartyl-L-α-glutamyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| Ac-DEE | ChEBI |
| Ac-L-Asp-L-Glu-L-Glu | ChEBI |
| N-acetylaspartylglutamylglutamic acid | ChEBI |
| N-acetyl-α-aspartyl-α-glutamylglutamic acid | ChEBI |