EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25NO4 |
| Net Charge | 0 |
| Average Mass | 355.434 |
| Monoisotopic Mass | 355.17836 |
| SMILES | COc1cc2c(cc1OC)[C@H]1Cc3cc(OC)c(OC)cc3[C@@H](C2)N1C |
| InChI | InChI=1S/C21H25NO4/c1-22-16-6-12-8-18(23-2)20(25-4)10-14(12)17(22)7-13-9-19(24-3)21(26-5)11-15(13)16/h8-11,16-17H,6-7H2,1-5H3/t16-,17-/m1/s1 |
| InChIKey | QEOWCPFWLCIQSL-IAGOWNOFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-argemonine (CHEBI:77059) is a 2,3,8,9-tetramethoxy-13-methyl-5,6,11,12-tetrahydro-5,11-epiminodibenzo[a,e][8]annulene (CHEBI:77060) |
| (+)-argemonine (CHEBI:77059) is enantiomer of (−)-argemonine (CHEBI:80) |
| Incoming Relation(s) |
| argemonine (CHEBI:77055) has part (+)-argemonine (CHEBI:77059) |
| (−)-argemonine (CHEBI:80) is enantiomer of (+)-argemonine (CHEBI:77059) |
| IUPAC Name |
|---|
| (5R,11R)-2,3,8,9-tetramethoxy-13-methyl-5,6,11,12-tetrahydro-5,11-epiminodibenzo[a,e][8]annulene |
| Synonyms | Source |
|---|---|
| (R,R)-argemonine | ChEBI |
| (R,R)-N-methylpavine | ChEBI |