EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23NO4 |
| Net Charge | 0 |
| Average Mass | 341.407 |
| Monoisotopic Mass | 341.16271 |
| SMILES | COc1cc2c(cc1OC)C1Cc3cc(OC)c(OC)cc3C(C2)N1 |
| InChI | InChI=1S/C20H23NO4/c1-22-17-7-11-5-15-14-10-20(25-4)18(23-2)8-12(14)6-16(21-15)13(11)9-19(17)24-3/h7-10,15-16,21H,5-6H2,1-4H3 |
| InChIKey | SRSPZLZVGPJHJH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3,8,9-tetramethoxy-5,6,11,12-tetrahydro-5,11-epiminodibenzo[a,e][8]annulene (CHEBI:77051) is a aromatic ether (CHEBI:35618) |
| 2,3,8,9-tetramethoxy-5,6,11,12-tetrahydro-5,11-epiminodibenzo[a,e][8]annulene (CHEBI:77051) is a isoquinoline alkaloid (CHEBI:24921) |
| 2,3,8,9-tetramethoxy-5,6,11,12-tetrahydro-5,11-epiminodibenzo[a,e][8]annulene (CHEBI:77051) is a organic heterotetracyclic compound (CHEBI:38163) |
| 2,3,8,9-tetramethoxy-5,6,11,12-tetrahydro-5,11-epiminodibenzo[a,e][8]annulene (CHEBI:77051) is a secondary amino compound (CHEBI:50995) |
| Incoming Relation(s) |
| (R,R)-pavine (CHEBI:77049) is a 2,3,8,9-tetramethoxy-5,6,11,12-tetrahydro-5,11-epiminodibenzo[a,e][8]annulene (CHEBI:77051) |
| (S,S)-pavine (CHEBI:77050) is a 2,3,8,9-tetramethoxy-5,6,11,12-tetrahydro-5,11-epiminodibenzo[a,e][8]annulene (CHEBI:77051) |
| IUPAC Name |
|---|
| 2,3,8,9-tetramethoxy-5,6,11,12-tetrahydro-5,11-epiminodibenzo[a,e][8]annulene |
| Synonym | Source |
|---|---|
| pavine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:343994 | Reaxys |