EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H11NO2 |
| Net Charge | 0 |
| Average Mass | 117.148 |
| Monoisotopic Mass | 117.07898 |
| SMILES | C[C@@H](C(=O)O)N(C)C |
| InChI | InChI=1S/C5H11NO2/c1-4(5(7)8)6(2)3/h4H,1-3H3,(H,7,8)/t4-/m0/s1 |
| InChIKey | QCYOIFVBYZNUNW-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-dimethyl-L-alanine (CHEBI:77042) is a methyl-L-alanine (CHEBI:25264) |
| Incoming Relation(s) |
| N,N-dimethyl-L-alanyl group (CHEBI:77037) is substituent group from N,N-dimethyl-L-alanine (CHEBI:77042) |
| IUPAC Name |
|---|
| N,N-dimethyl-L-alanine |
| Synonyms | Source |
|---|---|
| (2S)-2-(dimethylamino)propanoic acid | ChEBI |
| N,N-dimethylalanine | ChEBI |
| N(alpha),N(alpha)-Dimethylalanine | ChemIDplus |