EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO2 |
| Net Charge | 0 |
| Average Mass | 179.219 |
| Monoisotopic Mass | 179.09463 |
| SMILES | C[C@@H](c1ccccc1)[C@H](N)C(=O)O |
| InChI | InChI=1S/C10H13NO2/c1-7(9(11)10(12)13)8-5-3-2-4-6-8/h2-7,9H,11H2,1H3,(H,12,13)/t7-,9-/m0/s1 |
| InChIKey | IRZQDMYEJPNDEN-CBAPKCEASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,3S)-β-methylphenylalanine (CHEBI:77031) has functional parent L-phenylalanine (CHEBI:17295) |
| (2S,3S)-β-methylphenylalanine (CHEBI:77031) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| (2S,3S)-β-methylphenylalanine (CHEBI:77031) is tautomer of (2S,3S)-β-methylphenylalanine zwitterion (CHEBI:76864) |
| Incoming Relation(s) |
| (2S,3S)-β-methylphenylalanine zwitterion (CHEBI:76864) is tautomer of (2S,3S)-β-methylphenylalanine (CHEBI:77031) |
| IUPAC Name |
|---|
| (βS)-β-methyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| (2S,3S)-3-methylphenylalanine | ChEBI |
| (2S,3S)-2-amino-3-phenylbutanoic acid | ChEBI |
| (3S)-3-methyl-L-phenylalanine | ChEBI |
| erythro-(2S,3S)-2-amino-3-phenylbutanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-15345 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2834345 | Reaxys |
| Citations |
|---|