EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8N2O4 |
| Net Charge | 0 |
| Average Mass | 172.140 |
| Monoisotopic Mass | 172.04841 |
| SMILES | N[C@@H](Cc1cnoc1=O)C(=O)O |
| InChI | InChI=1S/C6H8N2O4/c7-4(5(9)10)1-3-2-8-12-6(3)11/h2,4,8H,1,7H2,(H,9,10)/t4-/m0/s1 |
| InChIKey | LVNJBTYSYFSYFG-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(5-oxoisoxazolin-4-yl)-L-alanine (CHEBI:77030) has role plant metabolite (CHEBI:76924) |
| 3-(5-oxoisoxazolin-4-yl)-L-alanine (CHEBI:77030) is a L-alanine derivative (CHEBI:83943) |
| 3-(5-oxoisoxazolin-4-yl)-L-alanine (CHEBI:77030) is a isoxazoles (CHEBI:55373) |
| 3-(5-oxoisoxazolin-4-yl)-L-alanine (CHEBI:77030) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 3-(5-oxoisoxazolin-4-yl)-L-alanine (CHEBI:77030) is tautomer of 3-(5-oxoisoxazolin-4-yl)-L-alanine zwitterion (CHEBI:76856) |
| Incoming Relation(s) |
| 3-(5-oxoisoxazolin-4-yl)-L-alanine zwitterion (CHEBI:76856) is tautomer of 3-(5-oxoisoxazolin-4-yl)-L-alanine (CHEBI:77030) |
| IUPAC Name |
|---|
| 3-(5-oxo-2,5-dihydro-1,2-oxazol-4-yl)-L-alanine |
| Synonym | Source |
|---|---|
| β-(isoxazolin-5-on-4-yl)-L-alanine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4842550 | Reaxys |
| Citations |
|---|