EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25N7O17P3 |
| Net Charge | -3 |
| Average Mass | 740.385 |
| Monoisotopic Mass | 740.05362 |
| SMILES | NC(=O)c1ccc[n+]([C@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])OC[C@H]3O[C@@H](n4cnc5c(N)ncnc54)[C@H](OP(=O)([O-])[O-])[C@@H]3O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C21H28N7O17P3/c22-17-12-19(25-7-24-17)28(8-26-12)21-16(44-46(33,34)35)14(30)11(43-21)6-41-48(38,39)45-47(36,37)40-5-10-13(29)15(31)20(42-10)27-3-1-2-9(4-27)18(23)32/h1-4,7-8,10-11,13-16,20-21,29-31H,5-6H2,(H7-,22,23,24,25,32,33,34,35,36,37,38,39)/p-3/t10-,11-,13-,14-,15-,16-,20+,21-/m1/s1 |
| InChIKey | XJLXINKUBYWONI-OPDHFMQKSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-NADP(3−) (CHEBI:77018) is a organophosphate oxoanion (CHEBI:58945) |
| α-NADP(3−) (CHEBI:77018) is conjugate base of α-NADP+ (CHEBI:77174) |
| Incoming Relation(s) |
| α-NADP+ (CHEBI:77174) is conjugate acid of α-NADP(3−) (CHEBI:77018) |
| Manual Xrefs | Databases |
|---|---|
| CPD-16007 | MetaCyc |
| Citations |
|---|