EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4O2Se |
| Net Charge | 0 |
| Average Mass | 127.001 |
| Monoisotopic Mass | 127.93765 |
| SMILES | C[Se](=O)O |
| InChI | InChI=1S/CH4O2Se/c1-4(2)3/h1H3,(H,2,3) |
| InChIKey | UEQANLFPOFICBH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylseleninic acid (CHEBI:77012) has functional parent seleninic acid (CHEBI:29218) |
| methylseleninic acid (CHEBI:77012) has role antineoplastic agent (CHEBI:35610) |
| methylseleninic acid (CHEBI:77012) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| methylseleninic acid (CHEBI:77012) has role human xenobiotic metabolite (CHEBI:76967) |
| methylseleninic acid (CHEBI:77012) is a one-carbon compound (CHEBI:64708) |
| methylseleninic acid (CHEBI:77012) is a organoselenium compound (CHEBI:25712) |
| IUPAC Name |
|---|
| methaneseleninic acid |
| Synonym | Source |
|---|---|
| Methylseleninate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C18902 | KEGG COMPOUND |
| Methaneseleninic_Acid | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1734752 | Reaxys |
| CAS:28274-57-9 | ChemIDplus |
| Citations |
|---|