EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H51NO10 |
| Net Charge | 0 |
| Average Mass | 597.746 |
| Monoisotopic Mass | 597.35130 |
| SMILES | CC[C@H]1OC(=O)C[C@@H](O)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)[C@@H](O)[C@H](N(C)C)[C@H]2O)[C@@H](CC=O)C[C@@H](C)C(=O)/C=C/C(C)=C/[C@@H]1CO |
| InChI | InChI=1S/C31H51NO10/c1-8-25-22(16-34)13-17(2)9-10-23(35)18(3)14-21(11-12-33)30(19(4)24(36)15-26(37)41-25)42-31-29(39)27(32(6)7)28(38)20(5)40-31/h9-10,12-13,18-22,24-25,27-31,34,36,38-39H,8,11,14-16H2,1-7H3/b10-9+,17-13+/t18-,19+,20-,21+,22-,24-,25-,27+,28-,29-,30-,31+/m1/s1 |
| InChIKey | WGUJDBLMJBJUQU-VKRLOHBMSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-O-mycaminosyltylonolide (CHEBI:77011) has functional parent tylactone (CHEBI:29700) |
| 5-O-mycaminosyltylonolide (CHEBI:77011) is a aldehyde (CHEBI:17478) |
| 5-O-mycaminosyltylonolide (CHEBI:77011) is a enone (CHEBI:51689) |
| 5-O-mycaminosyltylonolide (CHEBI:77011) is a macrolide antibiotic (CHEBI:25105) |
| 5-O-mycaminosyltylonolide (CHEBI:77011) is a monosaccharide derivative (CHEBI:63367) |
| 5-O-mycaminosyltylonolide (CHEBI:77011) is conjugate base of 5-O-mycaminosyltylonolide(1+) (CHEBI:76804) |
| Incoming Relation(s) |
| 5-O-mycaminosyltylonolide(1+) (CHEBI:76804) is conjugate acid of 5-O-mycaminosyltylonolide (CHEBI:77011) |
| IUPAC Name |
|---|
| (4R,5S,6S,7R,9R,11E,13E,15R,16R)-16-ethyl-4-hydroxy-15-(hydroxymethyl)-5,9,13-trimethyl-2,10-dioxo-7-(2-oxoethyl)oxacyclohexadeca-11,13-dien-6-yl 3,6-dideoxy-3-(dimethylamino)-β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 5-O-beta-D-Mycaminosyltylonolide | KEGG COMPOUND |
| O-Mycaminosyltylonolide | ChemIDplus |
| 5-O-(3,6-dideoxy-3-(dimethylamino)-beta-D-glucopyranosyl)-tylonolide | ChemIDplus |
| Mycaminosyltylonolide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C12002 | KEGG COMPOUND |
| WO2013076169 | Patent |
| US2006014707 | Patent |
| US4537957 | Patent |
| CPD-15944 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4730900 | Reaxys |
| CAS:61257-02-1 | ChemIDplus |