EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O3 |
| Net Charge | 0 |
| Average Mass | 376.496 |
| Monoisotopic Mass | 376.20384 |
| SMILES | [H][C@@]12CCc3cc(OC(=O)c4ccccc4)ccc3[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C25H28O3/c1-25-14-13-20-19-10-8-18(28-24(27)16-5-3-2-4-6-16)15-17(19)7-9-21(20)22(25)11-12-23(25)26/h2-6,8,10,15,20-23,26H,7,9,11-14H2,1H3/t20-,21-,22+,23+,25+/m1/s1 |
| InChIKey | UYIFTLBWAOGQBI-BZDYCCQFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | estrogen receptor agonist An agonist at the estrogen receptor. xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| Application: | xenoestrogen A synthetic or semi-synthetic compound that has oestrogenic activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17β-estradiol 3-benzoate (CHEBI:77006) has functional parent 17β-estradiol (CHEBI:16469) |
| 17β-estradiol 3-benzoate (CHEBI:77006) has role estrogen receptor agonist (CHEBI:63951) |
| 17β-estradiol 3-benzoate (CHEBI:77006) has role xenoestrogen (CHEBI:76988) |
| 17β-estradiol 3-benzoate (CHEBI:77006) is a 17β-hydroxy steroid (CHEBI:35343) |
| 17β-estradiol 3-benzoate (CHEBI:77006) is a benzoate ester (CHEBI:36054) |
| IUPAC Name |
|---|
| (17β)-17-hydroxyestra-1(10),2,4-trien-3-yl benzoate |
| INNs | Source |
|---|---|
| benzoate d'estradiol | ChemIDplus |
| benzoato de estradiol | ChemIDplus |
| estradiol benzoate | ChemIDplus |
| estradioli benzoas | ChemIDplus |
| Synonyms | Source |
|---|---|
| 17-beta-Estradiol 3-benzoate | KEGG COMPOUND |
| 17β-estradiol monobenzoate | ChemIDplus |
| estra-1,3,5(10)-triene-3,17β-diol 3-benzoate | ChemIDplus |
| estradiol monobenzoate | ChemIDplus |
| oestradiol 3-benzoate | ChemIDplus |
| oestradiol benzoate | ChEBI |
| Brand Names | Source |
|---|---|
| Agofollin Depot | ChemIDplus |
| Benovocylin | ChemIDplus |
| Benzo-Gynoestryl | ChemIDplus |
| Benztrone | ChemIDplus |
| Estrogin | NIST Chemistry WebBook |
| Folone | NIST Chemistry WebBook |
| Citations |
|---|