EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H12O2 |
| Net Charge | 0 |
| Average Mass | 272.303 |
| Monoisotopic Mass | 272.08373 |
| SMILES | O=c1cc(-c2ccccc2)oc2c1ccc1ccccc12 |
| InChI | InChI=1S/C19H12O2/c20-17-12-18(14-7-2-1-3-8-14)21-19-15-9-5-4-6-13(15)10-11-16(17)19/h1-12H |
| InChIKey | VFMMPHCGEFXGIP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 1.14.14.14 (aromatase) inhibitor An EC 1.14.14.* (oxidoreductase acting on paired donors, incorporating of 1 atom of oxygen, with reduced flavin or flavoprotein as one donor) inhibitor which interferes with the action of aromatase (EC 1.14.14.14) and so reduces production of estrogenic steroid hormones. aryl hydrocarbon receptor antagonist An antagonist that binds to and activates aryl hydrocarbon receptors (AhRs). aryl hydrocarbon receptor agonist An agonist that binds to and activates aryl hydrocarbon receptors (AhRs). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-naphthoflavone (CHEBI:76995) has role aryl hydrocarbon receptor agonist (CHEBI:72768) |
| α-naphthoflavone (CHEBI:76995) has role aryl hydrocarbon receptor antagonist (CHEBI:76998) |
| α-naphthoflavone (CHEBI:76995) has role EC 1.14.14.14 (aromatase) inhibitor (CHEBI:50790) |
| α-naphthoflavone (CHEBI:76995) is a extended flavonoid (CHEBI:71037) |
| α-naphthoflavone (CHEBI:76995) is a naphtho-γ-pyrone (CHEBI:64542) |
| α-naphthoflavone (CHEBI:76995) is a organic heterotricyclic compound (CHEBI:26979) |
| IUPAC Name |
|---|
| 2-phenyl-4H-benzo[h]chromen-4-one |
| Synonyms | Source |
|---|---|
| 2-phenyl-4H-naphtho(1,2-b)pyran-4-one | ChemIDplus |
| 7,8-benzoflavone | ChemIDplus |
| 7,8-BF | ChemIDplus |
| benzo[h]flavone | ChemIDplus |
| α-naphthylflavone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Alpha-Naphthoflavone | Wikipedia |
| BHF | PDBeChem |
| CPD-10550 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:210862 | Reaxys |
| CAS:604-59-1 | ChemIDplus |
| Citations |
|---|