EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9NO2 |
| Net Charge | 0 |
| Average Mass | 151.165 |
| Monoisotopic Mass | 151.06333 |
| SMILES | CC(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C8H9NO2/c1-6(10)9-7-3-2-4-8(11)5-7/h2-5,11H,1H3,(H,9,10) |
| InChIKey | QLNWXBAGRTUKKI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Application: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| metacetamol (CHEBI:76987) has role non-narcotic analgesic (CHEBI:35481) |
| metacetamol (CHEBI:76987) is a acetamides (CHEBI:22160) |
| metacetamol (CHEBI:76987) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| N-(3-hydroxyphenyl)acetamide |
| INNs | Source |
|---|---|
| metacetamol | WHO MedNet |
| metacetamol | ChemIDplus |
| métacétamol | WHO MedNet |
| metacetamolum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-acetamidophenol | ChemIDplus |
| 3-(acetylamino)-1-hydroxybenzene | ChemIDplus |
| 3-(acetylamino)phenol | ChemIDplus |
| 3-hydroxyacetanilide | ChemIDplus |
| m-acetamidophenol | ChemIDplus |
| m-(acetylamino)phenol | ChemIDplus |
| UniProt Name | Source |
|---|---|
| 3-acetamidophenol | UniProt |
| Citations |
|---|