EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H52O3 |
| Net Charge | 0 |
| Average Mass | 412.699 |
| Monoisotopic Mass | 412.39165 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C26H52O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25(27)26(28)29/h25,27H,2-24H2,1H3,(H,28,29) |
| InChIKey | IFYDZTDBJZWEPK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyhexacosanoic acid (CHEBI:76986) has functional parent hexacosanoic acid (CHEBI:31009) |
| 2-hydroxyhexacosanoic acid (CHEBI:76986) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxyhexacosanoic acid (CHEBI:76986) is a very long-chain fatty acid (CHEBI:27283) |
| 2-hydroxyhexacosanoic acid (CHEBI:76986) is conjugate acid of 2-hydroxyhexacosanoate (CHEBI:76728) |
| Incoming Relation(s) |
| N-(2-hydroxyhexacosanoyl)sphingosine (CHEBI:83363) has functional parent 2-hydroxyhexacosanoic acid (CHEBI:76986) |
| 2-hydroxyhexacosanoyl-CoA (CHEBI:136986) has functional parent 2-hydroxyhexacosanoic acid (CHEBI:76986) |
| 2-hydroxyhexacosanoate (CHEBI:76728) is conjugate base of 2-hydroxyhexacosanoic acid (CHEBI:76986) |
| IUPAC Name |
|---|
| 2-hydroxyhexacosanoic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxycerotic acid | ChEBI |
| α-hydroxycerotic acid | ChEBI |
| α-hydroxyhexacosanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01050218 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1803043 | Reaxys |
| CAS:14176-13-7 | ChemIDplus |