EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36O5 |
| Net Charge | 0 |
| Average Mass | 344.492 |
| Monoisotopic Mass | 344.25627 |
| SMILES | [H][C@@](CO)(COC(=O)CCCCCCC)OC(=O)CCCCCCC |
| InChI | InChI=1S/C19H36O5/c1-3-5-7-9-11-13-18(21)23-16-17(15-20)24-19(22)14-12-10-8-6-4-2/h17,20H,3-16H2,1-2H3/t17-/m1/s1 |
| InChIKey | ZQBULZYTDGUSSK-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,3-dioctanoyl-sn-glycerol (CHEBI:76982) is a 2,3-diacyl-sn-glycerol (CHEBI:75524) |
| 2,3-dioctanoyl-sn-glycerol (CHEBI:76982) is a dioctanoylglycerol (CHEBI:88066) |
| 2,3-dioctanoyl-sn-glycerol (CHEBI:76982) is enantiomer of 1,2-dioctanoyl-sn-glycerol (CHEBI:76979) |
| Incoming Relation(s) |
| 1,2-dioctanoyl-sn-glycerol (CHEBI:76979) is enantiomer of 2,3-dioctanoyl-sn-glycerol (CHEBI:76982) |
| IUPAC Name |
|---|
| (2R)-3-hydroxypropane-1,2-diyl dioctanoate |
| Synonyms | Source |
|---|---|
| 2,3-dicapryloyl-sn-glycerol | ChEBI |
| 2,3-dioctanoylglycerol | ChEBI |
| DG(0:0/8:0/8:0) | ChEBI |
| sn-2,3-dicaprilin | ChEBI |
| sn-2,3-dicapryloylglycerol | ChEBI |
| sn-2,3-dioctanoin | ChEBI |
| UniProt Name | Source |
|---|---|
| 2,3-dioctanoyl-sn-glycerol | UniProt |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7858077 | Reaxys |