EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H44O3 |
| Net Charge | 0 |
| Average Mass | 356.591 |
| Monoisotopic Mass | 356.32905 |
| SMILES | CCCCCCCCCCCCCCCCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C22H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(23)22(24)25/h21,23H,2-20H2,1H3,(H,24,25) |
| InChIKey | RPGJJWLCCOPDAZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxybehenic acid (CHEBI:76980) has functional parent docosanoic acid (CHEBI:28941) |
| 2-hydroxybehenic acid (CHEBI:76980) has role metabolite (CHEBI:25212) |
| 2-hydroxybehenic acid (CHEBI:76980) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxybehenic acid (CHEBI:76980) is a long-chain fatty acid (CHEBI:15904) |
| 2-hydroxybehenic acid (CHEBI:76980) is conjugate acid of 2-hydroxybehenate (CHEBI:76722) |
| Incoming Relation(s) |
| N-(2-hydroxybehenoyl)-D-galactosylsphingosine (CHEBI:83869) has functional parent 2-hydroxybehenic acid (CHEBI:76980) |
| 2-hydroxybehenate (CHEBI:76722) is conjugate base of 2-hydroxybehenic acid (CHEBI:76980) |
| IUPAC Name |
|---|
| 2-hydroxydocosanoic acid |
| Synonyms | Source |
|---|---|
| 2-hydroxy-22:0 fatty acid | MetaCyc |
| α-hydroxybehenic acid | ChEBI |
| α-hydroxydocosanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-9780 | MetaCyc |
| LMFA01050077 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728545 | Reaxys |
| CAS:13980-14-8 | ChemIDplus |
| Citations |
|---|