EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H50O6 |
| Net Charge | 0 |
| Average Mass | 470.691 |
| Monoisotopic Mass | 470.36074 |
| SMILES | CCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCC |
| InChI | InChI=1S/C27H50O6/c1-4-7-10-13-16-19-25(28)31-22-24(33-27(30)21-18-15-12-9-6-3)23-32-26(29)20-17-14-11-8-5-2/h24H,4-23H2,1-3H3 |
| InChIKey | VLPFTAMPNXLGLX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trioctanoin (CHEBI:76978) has role anticonvulsant (CHEBI:35623) |
| trioctanoin (CHEBI:76978) has role plant metabolite (CHEBI:76924) |
| trioctanoin (CHEBI:76978) is a octanoate ester (CHEBI:87657) |
| trioctanoin (CHEBI:76978) is a triglyceride (CHEBI:17855) |
| IUPAC Name |
|---|
| propane-1,2,3-triyl trioctanoate |
| Synonyms | Source |
|---|---|
| 1,2,3-Propanetriol trioctanoate | ChemIDplus |
| Caprylic acid, 1,2,3-propanetriyl ester | ChemIDplus |
| Caprylic acid triglyceride | ChemIDplus |
| Caprylic triglyceride | ChemIDplus |
| Caprylin | ChemIDplus |
| Glycerin tricaprylate | NIST Chemistry WebBook |
| Brand Name | Source |
|---|---|
| Axona | ChEBI |
| UniProt Name | Source |
|---|---|
| 1,2,3-trioctanoylglycerol | UniProt |
| Citations |
|---|