EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H50O6 |
| Net Charge | 0 |
| Average Mass | 470.691 |
| Monoisotopic Mass | 470.36074 |
| SMILES | CCCCCCCC(=O)OCC(COC(=O)CCCCCCC)OC(=O)CCCCCCC |
| InChI | InChI=1S/C27H50O6/c1-4-7-10-13-16-19-25(28)31-22-24(33-27(30)21-18-15-12-9-6-3)23-32-26(29)20-17-14-11-8-5-2/h24H,4-23H2,1-3H3 |
| InChIKey | VLPFTAMPNXLGLX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Applications: | anticonvulsant A drug used to prevent seizures or reduce their severity. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trioctanoin (CHEBI:76978) has role anticonvulsant (CHEBI:35623) |
| trioctanoin (CHEBI:76978) has role antispasmodic drug (CHEBI:53784) |
| trioctanoin (CHEBI:76978) has role immunosuppressive agent (CHEBI:35705) |
| trioctanoin (CHEBI:76978) has role plant metabolite (CHEBI:76924) |
| trioctanoin (CHEBI:76978) is a octanoate ester (CHEBI:87657) |
| trioctanoin (CHEBI:76978) is a triglyceride (CHEBI:17855) |
| IUPAC Name |
|---|
| propane-1,2,3-triyl trioctanoate |
| INNs | Source |
|---|---|
| tricaprilina | WHO MedNet |
| tricapriline | WHO MedNet |
| Synonyms | Source |
|---|---|
| 1,2,3-Propanetriol trioctanoate | ChemIDplus |
| AC-1202 | ChEMBL |
| AC-1204 | ChEMBL |
| Caprylic acid, 1,2,3-propanetriyl ester | ChemIDplus |
| Caprylic acid triglyceride | ChemIDplus |
| Caprylic triglyceride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Axona | ChEBI |
| UniProt Name | Source |
|---|---|
| 1,2,3-trioctanoylglycerol | UniProt |
| Citations |
|---|