EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | O=C(O)CCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCO |
| InChI | InChI=1S/C20H30O3/c21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20(22)23/h1,3-4,6-7,9-10,12-13,15,21H,2,5,8,11,14,16-19H2,(H,22,23)/b3-1-,6-4-,9-7-,12-10-,15-13- |
| InChIKey | PPMOWWAALQWWLJ-NUKMUHRASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 20-HEPE (CHEBI:76962) has functional parent all-cis-5,8,11,14,17-icosapentaenoic acid (CHEBI:28364) |
| 20-HEPE (CHEBI:76962) is a HEPE (CHEBI:72799) |
| 20-HEPE (CHEBI:76962) is a homoallylic alcohol (CHEBI:134362) |
| 20-HEPE (CHEBI:76962) is conjugate acid of 20-HEPE(1−) (CHEBI:76639) |
| Incoming Relation(s) |
| 20-HEPE(1−) (CHEBI:76639) is conjugate base of 20-HEPE (CHEBI:76962) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,14Z,17Z)-20-hydroxyicosa-5,8,11,14,17-pentaenoic acid |
| Synonyms | Source |
|---|---|
| 20-hydroxy-(5Z,8Z,11Z,14Z,17Z)-eicosapentaenoic acid | ChEBI |
| 20-hydroxy-(5Z,8Z,11Z,14Z,17Z)-icosapentaenoic acid | ChEBI |
| (5Z,8Z,11Z,14Z,17Z)-20-hydroxyeicosapentaenoic acid | ChEBI |
| (5Z,8Z,11Z,14Z,17Z)-20-hydroxyicosapentaenoic acid | ChEBI |
| Citations |
|---|