EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O3 |
| Net Charge | 0 |
| Average Mass | 318.457 |
| Monoisotopic Mass | 318.21949 |
| SMILES | CC[C@@H]1O[C@@H]1C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H30O3/c1-2-18-19(23-18)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-20(21)22/h3,5-6,8-9,11-12,14,18-19H,2,4,7,10,13,15-17H2,1H3,(H,21,22)/b5-3-,8-6-,11-9-,14-12-/t18-,19+/m0/s1 |
| InChIKey | GPQVVJQEBXAKBJ-VDTDYMMTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17(R),18(S)-EETeTr (CHEBI:76953) is a 17(18)-EpETE (CHEBI:72853) |
| 17(R),18(S)-EETeTr (CHEBI:76953) is conjugate acid of 17(R),18(S)-EETeTr(1−) (CHEBI:76634) |
| 17(R),18(S)-EETeTr (CHEBI:76953) is enantiomer of 17(S),18(R)-EETeTr (CHEBI:76955) |
| Incoming Relation(s) |
| 17(R),18(S)-EETeTr(1−) (CHEBI:76634) is conjugate base of 17(R),18(S)-EETeTr (CHEBI:76953) |
| 17(S),18(R)-EETeTr (CHEBI:76955) is enantiomer of 17(R),18(S)-EETeTr (CHEBI:76953) |
| IUPAC Name |
|---|
| (5Z,8Z,11Z,14Z)-16-[(2R,3S)-3-ethyloxiran-2-yl]hexadeca-5,8,11,14-tetraenoic acid |
| Synonyms | Source |
|---|---|
| (5Z,8Z,11Z,14Z,17R,18S)-17,18-epoxyicosatetraenoic acid | ChEBI |
| (17R,18S)-epoxy-(5Z,8Z,11Z,14Z)-icosatetraenoic acid | ChEBI |
| (17R,18S)-epoxy-(5Z,8Z,11Z,14Z)-eicosatetraenoic acid | ChEBI |
| (5Z,8Z,11Z,14Z,17R,18S)-17,18-epoxyeicosatetraenoic acid | ChEBI |
| 17R,18S-EpETE | LIPID MAPS |
| 17R,18S-epoxy-5Z,8Z,11Z,14Z-eicosatetraenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03000006 | LIPID MAPS |
| C13843 | KEGG COMPOUND |
| HMDB0010212 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20599768 | Reaxys |