EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@@]1(CC[C@](C)(O)C=C)C(=C)CC[C@]2([H])C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C20H34O/c1-7-19(5,21)14-11-16-15(2)9-10-17-18(3,4)12-8-13-20(16,17)6/h7,16-17,21H,1-2,8-14H2,3-6H3/t16-,17-,19-,20+/m1/s1 |
| InChIKey | CECREIRZLPLYDM-LFGUQSLTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ent-manool (CHEBI:76948) has role metabolite (CHEBI:25212) |
| ent-manool (CHEBI:76948) is a labdane diterpenoid (CHEBI:36770) |
| ent-manool (CHEBI:76948) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3S)-3-methyl-5-[(1R,4aR,8aR)-5,5,8a-trimethyl-2-methylenedecahydronaphthalen-1-yl]pent-1-en-3-ol |
| Synonyms | Source |
|---|---|
| (13S)-ent-manool | ChEBI |
| ent-labda-8(17),14-dien-13R-ol | ChEBI |
| UniProt Name | Source |
|---|---|
| ent-manool | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14032 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6177562 | Reaxys |
| Citations |
|---|