EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H34O |
| Net Charge | 0 |
| Average Mass | 290.491 |
| Monoisotopic Mass | 290.26097 |
| SMILES | [H][C@]1(CC[C@@](C)(O)C=C)C(=C)CC[C@@]2([H])C(C)(C)CCC[C@]12C |
| InChI | InChI=1S/C20H34O/c1-7-19(5,21)14-11-16-15(2)9-10-17-18(3,4)12-8-13-20(16,17)6/h7,16-17,21H,1-2,8-14H2,3-6H3/t16-,17-,19-,20+/m0/s1 |
| InChIKey | CECREIRZLPLYDM-QGZVKYPTSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| manool (CHEBI:76945) has role antibacterial agent (CHEBI:33282) |
| manool (CHEBI:76945) has role antineoplastic agent (CHEBI:35610) |
| manool (CHEBI:76945) has role plant metabolite (CHEBI:76924) |
| manool (CHEBI:76945) is a labdane diterpenoid (CHEBI:36770) |
| manool (CHEBI:76945) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3R)-3-methyl-5-[(1S,4aS,8aS)-5,5,8a-trimethyl-2-methylenedecahydronaphthalen-1-yl]pent-1-en-3-ol |
| Synonyms | Source |
|---|---|
| (13R)-labda-8(27),14-dien-13-ol | ChEBI |
| (13R)-manool | ChEBI |
| (13R)-Labda-8(20),14-dien-13-ol | ChemIDplus |
| (5S,9S,10S,13R)-labda-8(17),14-dien-13-ol | ChEBI |
| labda-8(17),14-dien-13(R)-ol | ChEBI |
| (+)-manool | ChEBI |
| UniProt Name | Source |
|---|---|
| manool | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-14028 | MetaCyc |
| WO2011123948 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5273610 | Reaxys |
| CAS:596-85-0 | ChemIDplus |
| Citations |
|---|