EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H48O3 |
| Net Charge | 0 |
| Average Mass | 384.645 |
| Monoisotopic Mass | 384.36035 |
| SMILES | O=C(O)CCCCCCCCCCCCCCCCCCCCCCCO |
| InChI | InChI=1S/C24H48O3/c25-23-21-19-17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-20-22-24(26)27/h25H,1-23H2,(H,26,27) |
| InChIKey | OVBKVWSHXDCSTK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ω-hydroxytetracosanoic acid (CHEBI:76930) has functional parent tetracosanoic acid (CHEBI:28866) |
| ω-hydroxytetracosanoic acid (CHEBI:76930) is a straight-chain fatty acid (CHEBI:59202) |
| ω-hydroxytetracosanoic acid (CHEBI:76930) is a ω-hydroxy-very-long-chain fatty acid (CHEBI:194304) |
| ω-hydroxytetracosanoic acid (CHEBI:76930) is conjugate acid of ω-hydroxytetracosanoate (CHEBI:76610) |
| Incoming Relation(s) |
| ω-hydroxytetracosanoate (CHEBI:76610) is conjugate base of ω-hydroxytetracosanoic acid (CHEBI:76930) |
| IUPAC Name |
|---|
| 24-hydroxytetracosanoic acid |
| Synonyms | Source |
|---|---|
| ω-hydroxylignoceric acid | ChEBI |
| 24-hydroxylignoceric acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1800490 | Reaxys |