EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C56H109NO14 |
| Net Charge | 0 |
| Average Mass | 1020.481 |
| Monoisotopic Mass | 1019.78481 |
| SMILES | CCCCCCCCCCCCCCCCCCCCCCCCCC(=O)N[C@@H](CO[C@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O)[C@H](O)[C@H](O)CCCCCCCCCCCCCC |
| InChI | InChI=1S/C56H109NO14/c1-3-5-7-9-11-13-15-17-18-19-20-21-22-23-24-25-26-27-29-31-33-35-37-39-47(61)57-43(48(62)44(60)38-36-34-32-30-28-16-14-12-10-8-6-4-2)42-68-55-53(67)51(65)54(46(41-59)70-55)71-56-52(66)50(64)49(63)45(40-58)69-56/h43-46,48-56,58-60,62-67H,3-42H2,1-2H3,(H,57,61)/t43-,44+,45+,46+,48-,49-,50-,51+,52+,53+,54+,55-,56-/m0/s1 |
| InChIKey | AMUNRMBXLQCRDG-RBDYWUHISA-N |
| Roles Classification |
|---|
| Biological Roles: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-O-(α-lactosyl)-N-hexacosanoylphytosphingosine (CHEBI:76911) has role antigen (CHEBI:59132) |
| 1-O-(α-lactosyl)-N-hexacosanoylphytosphingosine (CHEBI:76911) is a glycophytoceramide (CHEBI:59389) |
| IUPAC Name |
|---|
| N-[(2S,3S,4R)-1-[β-D-galactopyranosyl-(1→4)-α-D-glucopyranosyloxy]-3,4-dihydroxyoctadecan-2-yl]hexacosanamide |
| Synonyms | Source |
|---|---|
| 1-O-[β-D-galactopyranosyl-(1→4)-α-D-glucopyranosyl]-N-hexacosanoylphytosphingosine | ChEBI |
| 1-O-[β-D-galactosyl-(1→4)-α-D-glucosyl]-N-hexacosanoylphytosphingosine | ChEBI |
| Lacα-Cer(t18:0/26:0) | ChEBI |
| α-LacCer | ChEBI |
| α-LacCer(t18:0/26:0) | ChEBI |
| Citations |
|---|